Odorobioside G
Internal ID | 3eebb129-4d3b-4146-bae8-251a7ae3201f |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroid lactones > Cardenolides and derivatives > Cardenolide glycosides and derivatives |
IUPAC Name | 3-[(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-3-[(2R,3R,4R,5S,6R)-3-hydroxy-4-methoxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2CCC3(C(C2)CCC4C3CCC5(C4(CCC5C6=CC(=O)OC6)O)C)C)O)OC)OC7C(C(C(C(O7)CO)O)O)O |
SMILES (Isomeric) | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2CC[C@]3([C@@H](C2)CC[C@@H]4[C@@H]3CC[C@]5([C@@]4(CC[C@@H]5C6=CC(=O)OC6)O)C)C)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
InChI | InChI=1S/C36H56O13/c1-17-30(49-32-28(41)27(40)26(39)24(15-37)48-32)31(44-4)29(42)33(46-17)47-20-7-10-34(2)19(14-20)5-6-23-22(34)8-11-35(3)21(9-12-36(23,35)43)18-13-25(38)45-16-18/h13,17,19-24,26-33,37,39-43H,5-12,14-16H2,1-4H3/t17-,19-,20+,21-,22+,23-,24-,26-,27+,28-,29-,30+,31-,32+,33+,34+,35-,36+/m1/s1 |
InChI Key | LBCSKUSUYQVKDB-FEFGAQLCSA-N |
Popularity | 0 references in papers |
Molecular Formula | C36H56O13 |
Molecular Weight | 696.80 g/mol |
Exact Mass | 696.37209184 g/mol |
Topological Polar Surface Area (TPSA) | 194.00 Ų |
XlogP | 0.50 |
560-70-3 |
DTXSID501346882 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.01% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.56% | 96.09% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 95.69% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.06% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.89% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.47% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.02% | 94.45% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.34% | 96.77% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.10% | 94.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 88.41% | 97.36% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.70% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.41% | 95.56% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.25% | 92.94% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.23% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 85.91% | 98.95% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 85.38% | 81.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 84.47% | 95.93% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.22% | 95.89% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.90% | 96.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.60% | 92.50% |
CHEMBL1871 | P10275 | Androgen Receptor | 81.84% | 96.43% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.36% | 89.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.80% | 96.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 12313683 |
NPASS | NPC115721 |
LOTUS | LTS0235240 |
wikiData | Q104391763 |