Odoratol
Internal ID | c80fe926-fdc6-4bcb-b862-d3b3110fc7b7 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxy-dihydrochalcones |
IUPAC Name | 2-hydroxy-1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
SMILES (Canonical) | COC1=CC=C(C=C1)CC(C(=O)C2=C(C=C(C=C2)OC)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)CC(C(=O)C2=C(C=C(C=C2)OC)O)O |
InChI | InChI=1S/C17H18O5/c1-21-12-5-3-11(4-6-12)9-16(19)17(20)14-8-7-13(22-2)10-15(14)18/h3-8,10,16,18-19H,9H2,1-2H3 |
InChI Key | PPOABILDHKLUET-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C17H18O5 |
Molecular Weight | 302.32 g/mol |
Exact Mass | 302.11542367 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 3.10 |
94943-12-1 |
2-hydroxy-1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
alpha,2'-dihydroxy-4,4'-dimethoxydihydrochalcone |
C09807 |
CHEBI:7729 |
DTXSID80331829 |
Q27107570 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.55% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 97.30% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.32% | 91.11% |
CHEMBL4208 | P20618 | Proteasome component C5 | 93.19% | 90.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.14% | 99.17% |
CHEMBL2535 | P11166 | Glucose transporter | 92.56% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.90% | 99.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.05% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.79% | 96.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.60% | 94.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.15% | 95.50% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.44% | 90.24% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.90% | 94.45% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 82.17% | 97.21% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.83% | 86.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.60% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.25% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cedrela fissilis |
Cedrela odorata |
Lathyrus odoratus |
Myristica malabarica |
Pterocarpus angolensis |
Virola surinamensis |
PubChem | 442440 |
LOTUS | LTS0163594 |
wikiData | Q27107570 |