Obtusastyrene
Internal ID | c8f5e783-3ac2-4a52-b6fc-3ae4b6c13572 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Cinnamylphenols |
IUPAC Name | 4-[(E)-3-phenylprop-2-enyl]phenol |
SMILES (Canonical) | C1=CC=C(C=C1)C=CCC2=CC=C(C=C2)O |
SMILES (Isomeric) | C1=CC=C(C=C1)/C=C/CC2=CC=C(C=C2)O |
InChI | InChI=1S/C15H14O/c16-15-11-9-14(10-12-15)8-4-7-13-5-2-1-3-6-13/h1-7,9-12,16H,8H2/b7-4+ |
InChI Key | YNPGXIGIEYOFEX-QPJJXVBHSA-N |
Popularity | 12 references in papers |
Molecular Formula | C15H14O |
Molecular Weight | 210.27 g/mol |
Exact Mass | 210.104465066 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 4.10 |
4-Cinnamylphenol |
24126-82-7 |
4-[(E)-3-phenylprop-2-enyl]phenol |
AI3-29066 |
Phenol, 4-(3-phenyl-2-propenyl)- |
21148-30-1 |
SCHEMBL1577000 |
NSC154312 |
NSC-154312 |
![2D Structure of Obtusastyrene 2D Structure of Obtusastyrene](https://plantaedb.com/storage/docs/compounds/2023/11/obtusastyrene.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 96.11% | 91.71% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 95.26% | 94.62% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.29% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.73% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.19% | 98.95% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 88.36% | 89.44% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.30% | 95.56% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.72% | 95.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.35% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 85.42% | 89.67% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.32% | 93.99% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 82.53% | 94.08% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 82.25% | 94.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dalbergia retusa |
PubChem | 5793914 |
LOTUS | LTS0106483 |
wikiData | Q105351059 |