Novacine
Internal ID | 08dae918-4db7-4efe-8837-7b5a72bad571 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
IUPAC Name | (1S,10S,22R,23R,24S)-16,17-dimethoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14,16,18-tetraene-12,20-dione |
SMILES (Canonical) | CN1CCC23C4C5C(CC2=O)C(=CCOC5CC(=O)N4C6=CC(=C(C=C36)OC)OC)C1 |
SMILES (Isomeric) | CN1CC[C@]23[C@@H]4[C@H]5[C@@H](CC2=O)C(=CCO[C@H]5CC(=O)N4C6=CC(=C(C=C36)OC)OC)C1 |
InChI | InChI=1S/C24H28N2O5/c1-25-6-5-24-15-9-17(29-2)18(30-3)10-16(15)26-21(28)11-19-22(23(24)26)14(8-20(24)27)13(12-25)4-7-31-19/h4,9-10,14,19,22-23H,5-8,11-12H2,1-3H3/t14-,19-,22-,23-,24+/m0/s1 |
InChI Key | POLBLONFVZXVPI-SVFVWZOVSA-N |
Popularity | 3 references in papers |
Molecular Formula | C24H28N2O5 |
Molecular Weight | 424.50 g/mol |
Exact Mass | 424.19982200 g/mol |
Topological Polar Surface Area (TPSA) | 68.30 Ų |
XlogP | 0.20 |
CHEMBL2164627 |
CHEBI:132669 |
2,3-dimethoxy-19-methyl-16,19-seco-strychnidine-10,16-dione |
(1S,10S,22R,23R,24S)-16,17-dimethoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,14,16,18-tetraene-12,20-dione |
(4aR,6aS,12aS,12bR,12cS)-8,9-dimethoxy-15-methyl-4a,5,12,12a,12b,12c-hexahydro-11H-6a,4-(ethanoiminomethano)-1-oxa-10b-azacyclohepta[1,2,3-cd]fluoranthene-6,11(2H)-dione |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL204 | P00734 | Thrombin | 97.74% | 96.01% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.73% | 90.71% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 95.52% | 94.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.43% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.24% | 85.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 92.25% | 93.40% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.57% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 87.72% | 98.95% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 86.57% | 97.33% |
CHEMBL5747 | Q92793 | CREB-binding protein | 86.45% | 95.12% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 86.11% | 98.00% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 85.71% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.86% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.19% | 99.23% |
CHEMBL2850 | P49840 | Glycogen synthase kinase-3 alpha | 83.30% | 88.84% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 83.23% | 95.62% |
CHEMBL4940 | P07195 | L-lactate dehydrogenase B chain | 82.81% | 95.53% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 82.66% | 90.24% |
CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.59% | 96.39% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.48% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 80.22% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Strychnos icaja |
Strychnos nux-vomica |
Strychnos wallichiana |
PubChem | 12314414 |
LOTUS | LTS0180715 |
wikiData | Q104394066 |