Norsanguinine
| Internal ID | e3561e7a-efe6-424f-a84e-5713a16b26c1 |
| Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Galanthamine-type amaryllidaceae alkaloids |
| IUPAC Name | (1S,12S,14R)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraene-9,14-diol |
| SMILES (Canonical) | C1CNCC2=C3C14C=CC(CC4OC3=C(C=C2)O)O |
| SMILES (Isomeric) | C1CNCC2=C3[C@@]14C=C[C@@H](C[C@@H]4OC3=C(C=C2)O)O |
| InChI | InChI=1S/C15H17NO3/c17-10-3-4-15-5-6-16-8-9-1-2-11(18)14(13(9)15)19-12(15)7-10/h1-4,10,12,16-18H,5-8H2/t10-,12-,15-/m0/s1 |
| InChI Key | UAJBMQOTHJIJOI-WBIUFABUSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 61.70 Ų |
| XlogP | 1.00 |
| CHEMBL1523 |
| CHEBI:31920 |
| C12253 |
| AC1L9F3P |
| SureCN14581279 |
| SCHEMBL14581279 |
| CHEBI:521446 |
| BDBM50221061 |
| AKOS004902639 |
| Q27114720 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.25% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.84% | 97.09% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.63% | 96.09% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.74% | 91.49% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.01% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 90.12% | 93.99% |
| CHEMBL233 | P35372 | Mu opioid receptor | 86.59% | 97.93% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.23% | 95.89% |
| CHEMBL238 | Q01959 | Dopamine transporter | 86.20% | 95.88% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.18% | 99.15% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.42% | 97.79% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.59% | 100.00% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.77% | 96.39% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.03% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.58% | 95.56% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.26% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Embelia ribes |
| Hosta plantaginea |
| Lycoris sanguinea |
| PubChem | 443739 |
| LOTUS | LTS0234204 |
| wikiData | Q104938106 |