Nopol
| Internal ID | 6e4e5fe3-a8a8-4cf8-97c8-99f409bf8340 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | 2-(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)ethanol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C11H18O/c1-11(2)9-4-3-8(5-6-12)10(11)7-9/h3,9-10,12H,4-7H2,1-2H3 |
| InChI Key | ROKSAUSPJGWCSM-UHFFFAOYSA-N |
| Popularity | 145 references in papers |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.135765193 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 2.10 |
| 128-50-7 |
| Homomyrtenol |
| Nopol (terpene) |
| Bicyclo[3.1.1]hept-2-ene-2-ethanol, 6,6-dimethyl- |
| 6,6-Dimethyl-2-norpinene-2-ethanol |
| 2-NORPINENE-2-ETHANOL, 6,6-DIMETHYL- |
| 6,6-Dimethyl-2-(2-hydroxyethyl)-2-norpinene |
| Bicyclo(3.1.1)hept-2-ene-2-ethanol, 6,6-dimethyl- |
| Homomyretenol |
| 2-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}ethan-1-ol |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.59% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.04% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.28% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.75% | 97.09% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 83.24% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.03% | 94.45% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.77% | 86.92% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 81.66% | 97.79% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.30% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Daucus carota |
| PubChem | 31408 |
| LOTUS | LTS0070084 |
| wikiData | Q27293876 |