nonadecyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate
Internal ID | 4b1e1d8c-263b-4ea9-8761-6559baa31f84 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | nonadecyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCOC(=O)C=CC1=CC(=C(C=C1)O)OC |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCOC(=O)/C=C/C1=CC(=C(C=C1)O)OC |
InChI | InChI=1S/C29H48O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-33-29(31)23-21-26-20-22-27(30)28(25-26)32-2/h20-23,25,30H,3-19,24H2,1-2H3/b23-21+ |
InChI Key | ZBHBGEFUKBOWPQ-XTQSDGFTSA-N |
Popularity | 3 references in papers |
Molecular Formula | C29H48O4 |
Molecular Weight | 460.70 g/mol |
Exact Mass | 460.35526001 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 11.20 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.60% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.59% | 91.11% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.26% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.49% | 96.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 96.03% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 94.53% | 90.71% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 92.86% | 92.08% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 91.05% | 80.78% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.02% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.42% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 88.07% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.42% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.71% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.91% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.07% | 90.71% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.34% | 96.95% |
CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 80.30% | 100.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.19% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Juniperus formosana |
Pavetta owariensis |
Spiraea formosana |
PubChem | 101186931 |
LOTUS | LTS0211965 |
wikiData | Q105370589 |