Nocazine B
| Internal ID | 12c9fe4e-abd0-43a3-a4a9-3b0af7716ea0 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines > Methoxypyrazines |
| IUPAC Name | (3Z,6Z)-3-benzylidene-5-methoxy-6-[(4-methoxyphenyl)methylidene]-1-methylpyrazin-2-one |
| SMILES (Canonical) | CN1C(=CC2=CC=C(C=C2)OC)C(=NC(=CC3=CC=CC=C3)C1=O)OC |
| SMILES (Isomeric) | CN1/C(=C\C2=CC=C(C=C2)OC)/C(=N/C(=C\C3=CC=CC=C3)/C1=O)OC |
| InChI | InChI=1S/C21H20N2O3/c1-23-19(14-16-9-11-17(25-2)12-10-16)20(26-3)22-18(21(23)24)13-15-7-5-4-6-8-15/h4-14H,1-3H3/b18-13-,19-14- |
| InChI Key | NCBOROGHSUXZPE-SXQSXHJWSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14739250 g/mol |
| Topological Polar Surface Area (TPSA) | 51.10 Ų |
| XlogP | 3.70 |
| CHEBI:69709 |
| CHEMBL1835446 |
| Q27138052 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.15% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.05% | 86.33% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.40% | 96.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 93.07% | 91.49% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.30% | 98.95% |
| CHEMBL2039 | P27338 | Monoamine oxidase B | 89.80% | 92.51% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.66% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.96% | 99.23% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.82% | 95.50% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.70% | 93.99% |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 84.68% | 94.08% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 82.94% | 94.62% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.69% | 93.31% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Castanea crenata |
| Castanea sativa |
| Quercus robur |
| Quercus suber |
| PubChem | 56600877 |
| LOTUS | LTS0089169 |
| wikiData | Q104389426 |