Nimonol
Internal ID | 1010f494-e069-4dc9-81bf-a89214ad2533 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
IUPAC Name | [(5R,6R,7S,8R,9R,10R,13S,17R)-17-(furan-3-yl)-6-hydroxy-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-7-yl] acetate |
SMILES (Canonical) | CC(=O)OC1C(C2C(C(=O)C=CC2(C3C1(C4=CCC(C4(CC3)C)C5=COC=C5)C)C)(C)C)O |
SMILES (Isomeric) | CC(=O)O[C@@H]1[C@@H]([C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4(CC3)C)C5=COC=C5)C)C)O |
InChI | InChI=1S/C28H36O5/c1-16(29)33-24-22(31)23-25(2,3)21(30)10-13-27(23,5)20-9-12-26(4)18(17-11-14-32-15-17)7-8-19(26)28(20,24)6/h8,10-11,13-15,18,20,22-24,31H,7,9,12H2,1-6H3/t18-,20+,22+,23-,24+,26-,27+,28-/m0/s1 |
InChI Key | GDMYRVKWBYREMU-XMLHTYRRSA-N |
Popularity | 4 references in papers |
Molecular Formula | C28H36O5 |
Molecular Weight | 452.60 g/mol |
Exact Mass | 452.25627424 g/mol |
Topological Polar Surface Area (TPSA) | 76.70 Ų |
XlogP | 4.70 |
CHEMBL2386304 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.07% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.11% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.38% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 91.90% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.31% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.35% | 97.25% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.60% | 100.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 88.79% | 82.69% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.71% | 91.19% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.48% | 81.11% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 86.06% | 96.77% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.95% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.51% | 95.89% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.01% | 99.23% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 81.95% | 91.24% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 81.63% | 97.28% |
CHEMBL5028 | O14672 | ADAM10 | 81.53% | 97.50% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 80.72% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.05% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Azadirachta indica |
Turraea pubescens |
PubChem | 73356511 |
LOTUS | LTS0129588 |
wikiData | Q105006821 |