Nigrolineabiphenyl A
| Internal ID | 5bcb099f-4699-4250-ac3f-b93987b1c810 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenols |
| IUPAC Name | 4-(4-hydroxy-3,5-dimethoxyphenyl)benzene-1,2-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H14O5/c1-18-12-6-9(7-13(19-2)14(12)17)8-3-4-10(15)11(16)5-8/h3-7,15-17H,1-2H3 |
| InChI Key | ZZOCAYOGNJRKQA-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08412354 g/mol |
| Topological Polar Surface Area (TPSA) | 79.20 Ų |
| XlogP | 2.40 |
| 4-(4-Hydroxy-3,5-dimethoxyphenyl)benzene-1,2-diol |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.86% | 91.11% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 95.22% | 98.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.99% | 96.09% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.69% | 99.15% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.98% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.10% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.89% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.04% | 94.00% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 85.12% | 89.32% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 84.08% | 88.48% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.90% | 92.94% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 83.05% | 93.31% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 82.56% | 92.68% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.84% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.90% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 80.76% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.73% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia nigrolineata |
| PubChem | 11572481 |
| LOTUS | LTS0170927 |
| wikiData | Q105386948 |