Naphtho(2,3-b)furan-4,9-dione, 5-hydroxy-
Internal ID | 36c50cf8-2e88-4789-875e-9c44ac103964 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | 5-hydroxybenzo[f][1]benzofuran-4,9-dione |
SMILES (Canonical) | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)OC=C3 |
SMILES (Isomeric) | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)OC=C3 |
InChI | InChI=1S/C12H6O4/c13-8-3-1-2-6-9(8)10(14)7-4-5-16-12(7)11(6)15/h1-5,13H |
InChI Key | IXMPDWSXRSNDPG-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H6O4 |
Molecular Weight | 214.17 g/mol |
Exact Mass | 214.02660867 g/mol |
Topological Polar Surface Area (TPSA) | 67.50 Ų |
XlogP | 2.50 |
Naphtho(2,3-b)furan-4,9-dione, 5-hydroxy- |
Diodantunezone |
SCHEMBL867205 |
DTXSID00237076 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.58% | 91.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.58% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.29% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.99% | 99.23% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.86% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.74% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 88.03% | 94.73% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.40% | 99.15% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 84.57% | 96.67% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.23% | 94.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lantana achyranthifolia |
Lantana camara |
PubChem | 181936 |
LOTUS | LTS0041372 |
wikiData | Q83119161 |