Naphtho[2,3-b]furan-4,9-dione, 2-acetyl-8-hydroxy-
Internal ID | 9251987a-ba0c-428e-9c27-1d0ad84ef6e6 |
Taxonomy | Organoheterocyclic compounds > Naphthofurans |
IUPAC Name | 2-acetyl-8-hydroxybenzo[f][1]benzofuran-4,9-dione |
SMILES (Canonical) | CC(=O)C1=CC2=C(O1)C(=O)C3=C(C2=O)C=CC=C3O |
SMILES (Isomeric) | CC(=O)C1=CC2=C(O1)C(=O)C3=C(C2=O)C=CC=C3O |
InChI | InChI=1S/C14H8O5/c1-6(15)10-5-8-12(17)7-3-2-4-9(16)11(7)13(18)14(8)19-10/h2-5,16H,1H3 |
InChI Key | MYDAXHYLQBNETF-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C14H8O5 |
Molecular Weight | 256.21 g/mol |
Exact Mass | 256.03717335 g/mol |
Topological Polar Surface Area (TPSA) | 84.60 Ų |
XlogP | 2.50 |
123297-91-6 |
CHEMBL493650 |
SCHEMBL20187568 |
DTXSID30432299 |
PMID26394986-Compound-50 |
![2D Structure of Naphtho[2,3-b]furan-4,9-dione, 2-acetyl-8-hydroxy- 2D Structure of Naphtho[2,3-b]furan-4,9-dione, 2-acetyl-8-hydroxy-](https://plantaedb.com/storage/docs/compounds/2023/07/naphtho23-bfuran-49-dione-2-acetyl-8-hydroxy-.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.87% | 98.95% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.57% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.65% | 94.73% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.84% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.22% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.20% | 89.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.49% | 99.23% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.20% | 86.33% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.98% | 93.65% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.73% | 94.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.74% | 96.95% |
CHEMBL2535 | P11166 | Glucose transporter | 84.50% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.62% | 99.15% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.11% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Handroanthus impetiginosus |
PubChem | 9881541 |
NPASS | NPC252208 |
ChEMBL | CHEMBL493650 |
LOTUS | LTS0226131 |
wikiData | Q82246371 |