N-Phenethylbenzamide
| Internal ID | be97a953-434c-443e-89f5-aefc52db470d |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-(2-phenylethyl)benzamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H15NO/c17-15(14-9-5-2-6-10-14)16-12-11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,16,17) |
| InChI Key | DAVRGGJTJDTVQT-UHFFFAOYSA-N |
| Popularity | 39 references in papers |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.115364102 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 3.20 |
| 3278-14-6 |
| N-(2-Phenylethyl)benzamide |
| N-phenethyl-benzamide |
| Benzamide, N-(2-phenylethyl)- |
| 4-(DICHLOROMETHYL)PYRIDINE HCL |
| NSC 16618 |
| NSC 43723 |
| N-phenethyl benzamide |
| Benzamide, N-(2-phenylethyl)- (9CI) |
| N-(2-Phenethyl)benzamide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 96.27% | 87.67% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.36% | 90.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 94.01% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 92.84% | 89.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 92.80% | 81.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.75% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.42% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.92% | 99.17% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 84.12% | 90.20% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 83.96% | 100.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.26% | 98.75% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 82.89% | 93.81% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.79% | 94.73% |
| CHEMBL5028 | O14672 | ADAM10 | 80.27% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haplophyllum tuberculatum |
| PubChem | 95083 |
| LOTUS | LTS0082870 |
| wikiData | Q72500885 |