N-Methylanthranilic acid
| Internal ID | bc746dee-ff0b-45db-b001-7b3293a1cc6e |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Aminobenzoic acids and derivatives > Aminobenzoic acids |
| IUPAC Name | 2-(methylamino)benzoic acid |
| SMILES (Canonical) | CNC1=CC=CC=C1C(=O)O |
| SMILES (Isomeric) | CNC1=CC=CC=C1C(=O)O |
| InChI | InChI=1S/C8H9NO2/c1-9-7-5-3-2-4-6(7)8(10)11/h2-5,9H,1H3,(H,10,11) |
| InChI Key | WVMBPWMAQDVZCM-UHFFFAOYSA-N |
| Popularity | 126 references in papers |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.063328530 g/mol |
| Topological Polar Surface Area (TPSA) | 49.30 Ų |
| XlogP | 2.00 |
| 2-(Methylamino)benzoic acid |
| 119-68-6 |
| N-Methyl-2-aminobenzoic acid |
| Benzoic acid, 2-(methylamino)- |
| N-Methyl-o-aminobenzoic acid |
| o-(Methylamino)benzoic acid |
| Anthranilic acid, N-methyl- |
| Kyselina N-methylanthranilova |
| Kyselina 2-methylaminobenzoova |
| N-methyl-anthranilic acid |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.86% | 98.95% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 90.78% | 87.67% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.33% | 96.09% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.32% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.58% | 95.56% |
| CHEMBL5847 | P52895 | Aldo-keto reductase family 1 member C2 | 85.72% | 92.50% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 83.70% | 90.17% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.69% | 81.11% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.65% | 91.11% |
| CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 82.46% | 89.23% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.81% | 93.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 80.57% | 94.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ruta graveolens |
| Siphonochilus aethiopicus |
| Zanthoxylum integrifoliolum |
| PubChem | 67069 |
| LOTUS | LTS0121854 |
| wikiData | Q27101885 |