N-feruloyl-N-methyltyramine
| Internal ID | 4bef9384-63bd-4f35-94cb-95824b14048c |
| Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives |
| IUPAC Name | (E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]-N-methylprop-2-enamide |
| SMILES (Canonical) | CN(CCC1=CC=C(C=C1)O)C(=O)C=CC2=CC(=C(C=C2)O)OC |
| SMILES (Isomeric) | CN(CCC1=CC=C(C=C1)O)C(=O)/C=C/C2=CC(=C(C=C2)O)OC |
| InChI | InChI=1S/C19H21NO4/c1-20(12-11-14-3-7-16(21)8-4-14)19(23)10-6-15-5-9-17(22)18(13-15)24-2/h3-10,13,21-22H,11-12H2,1-2H3/b10-6+ |
| InChI Key | PLPYUGCDZJGGIM-UXBLZVDNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 70.00 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.49% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.23% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.09% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.67% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.49% | 98.95% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.51% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.10% | 95.56% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.71% | 90.20% |
| CHEMBL3194 | P02766 | Transthyretin | 91.66% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.74% | 95.50% |
| CHEMBL2535 | P11166 | Glucose transporter | 87.56% | 98.75% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.88% | 91.71% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.47% | 96.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.24% | 89.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 85.19% | 93.10% |
| CHEMBL1921 | P47901 | Vasopressin V1b receptor | 83.59% | 92.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.86% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.34% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Galanthus elwesii |
| PubChem | 129661756 |
| LOTUS | LTS0171475 |
| wikiData | Q105211126 |