N-Ethylpropionamide
| Internal ID | f73b71c9-6311-4af9-bd57-dd5cd8dd01d4 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Carboxylic acid derivatives > Carboxylic acid amides > Secondary carboxylic acid amides |
| IUPAC Name | N-ethylpropanamide |
| SMILES (Canonical) | CCC(=O)NCC |
| SMILES (Isomeric) | CCC(=O)NCC |
| InChI | InChI=1S/C5H11NO/c1-3-5(7)6-4-2/h3-4H2,1-2H3,(H,6,7) |
| InChI Key | ABMDIECEEGFXNC-UHFFFAOYSA-N |
| Popularity | 29 references in papers |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.084063974 g/mol |
| Topological Polar Surface Area (TPSA) | 29.10 Ų |
| XlogP | 0.40 |
| 5129-72-6 |
| N-Ethylpropanamide |
| Propanamide, N-ethyl- |
| Propionamide, N-ethyl- |
| N-Propionylethylamine |
| N-Ethylpropanamide # |
| N,N'-diethylformamide |
| N-ethylpropionic acid amide |
| SCHEMBL95875 |
| SCHEMBL13662026 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 95.39% | 83.82% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.70% | 98.95% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 87.78% | 98.59% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.36% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 82.44% | 90.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.17% | 96.95% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.11% | 94.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 80.75% | 100.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.38% | 99.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 80.22% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Camellia sinensis |
| PubChem | 521324 |
| LOTUS | LTS0170858 |
| wikiData | Q82100496 |