N-Ethoxycarbonylethylcrinasiadine
| Internal ID | 211f8bd2-0e71-455d-b090-f7b07a6eac0b |
| Taxonomy | Alkaloids and derivatives > Amaryllidaceae alkaloids > Phenanthridine- and phenanthridone-type amaryllidaceae alkaloids |
| IUPAC Name | ethyl 3-(6-oxo-[1,3]dioxolo[4,5-j]phenanthridin-5-yl)propanoate |
| SMILES (Canonical) | CCOC(=O)CCN1C2=CC=CC=C2C3=CC4=C(C=C3C1=O)OCO4 |
| SMILES (Isomeric) | CCOC(=O)CCN1C2=CC=CC=C2C3=CC4=C(C=C3C1=O)OCO4 |
| InChI | InChI=1S/C19H17NO5/c1-2-23-18(21)7-8-20-15-6-4-3-5-12(15)13-9-16-17(25-11-24-16)10-14(13)19(20)22/h3-6,9-10H,2,7-8,11H2,1H3 |
| InChI Key | NITMZBGVDDZNHZ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.11067264 g/mol |
| Topological Polar Surface Area (TPSA) | 65.10 Ų |
| XlogP | 2.60 |
| CHEMBL2208206 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.66% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 95.60% | 96.77% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.31% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.17% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.34% | 86.33% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 91.01% | 92.62% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.50% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 89.06% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.22% | 91.11% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.54% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.47% | 99.17% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 83.58% | 98.59% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.38% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.00% | 90.00% |
| CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 80.06% | 94.80% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zephyranthes candida |
| PubChem | 71454344 |
| LOTUS | LTS0089917 |
| wikiData | Q105179994 |