N-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]acetamide
| Internal ID | 493fc79b-5240-4190-9e59-db8bdceb2582 |
| Taxonomy | Alkaloids and derivatives > Lupin alkaloids > Cytisine and derivatives |
| IUPAC Name | N-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]acetamide |
| SMILES (Canonical) | CC(=O)NCN1CC2CC(C1)C3=CC=CC(=O)N3C2 |
| SMILES (Isomeric) | CC(=O)NCN1CC2CC(C1)C3=CC=CC(=O)N3C2 |
| InChI | InChI=1S/C14H19N3O2/c1-10(18)15-9-16-6-11-5-12(8-16)13-3-2-4-14(19)17(13)7-11/h2-4,11-12H,5-9H2,1H3,(H,15,18) |
| InChI Key | FRRVGRCLXTXJOB-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.147726857 g/mol |
| Topological Polar Surface Area (TPSA) | 52.60 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
![2D Structure of N-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]acetamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-6-oxo-711-diazatricyclo731027trideca-24-dien-11-ylmethylacetamide.jpg "2D Structure of N-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methyl]acetamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.50% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 97.03% | 98.95% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.74% | 85.14% |
| CHEMBL1907588 | P02708 | Acetylcholine receptor; alpha1/beta1/delta/gamma | 87.76% | 98.33% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.73% | 95.56% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.58% | 97.09% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 84.32% | 98.59% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.30% | 99.23% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.10% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.44% | 89.00% |
| CHEMBL4805 | Q99572 | P2X purinoceptor 7 | 80.44% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Maackia hupehensis |
| PubChem | 73201090 |
| LOTUS | LTS0111459 |
| wikiData | Q105000401 |