N-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide
| Internal ID | 4be0c3a1-300f-4300-9fdc-d39973b2cb11 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzoic acids and derivatives > Benzamides |
| IUPAC Name | N-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C16H17NO3/c1-20-14-9-7-12(8-10-14)15(18)11-17-16(19)13-5-3-2-4-6-13/h2-10,15,18H,11H2,1H3,(H,17,19)/t15-/m0/s1 |
| InChI Key | NICURWGAEFHESQ-HNNXBMFYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12084340 g/mol |
| Topological Polar Surface Area (TPSA) | 58.60 Ų |
| XlogP | 2.00 |
| There are no found synonyms. |
![2D Structure of N-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-2r-2-hydroxy-2-4-methoxyphenylethylbenzamide.jpg "2D Structure of N-[(2R)-2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 97.60% | 90.17% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.54% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.69% | 96.09% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 95.54% | 87.67% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 94.65% | 81.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.32% | 90.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.60% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.00% | 98.95% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.02% | 91.11% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.62% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.98% | 99.17% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 89.77% | 96.67% |
| CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 89.01% | 89.33% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 87.38% | 93.81% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.28% | 96.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.25% | 91.07% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.01% | 83.82% |
| CHEMBL240 | Q12809 | HERG | 83.15% | 89.76% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.27% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.54% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Clausena brevistyla |
| Feroniella lucida |
| Philotheca tomentella |
| Zanthoxylum fagara |
| PubChem | 10084553 |
| LOTUS | LTS0096151 |
| wikiData | Q105179741 |