N-(2'-(R)-hydroxylignoceroyl)-D-erythro-sphingosine
Internal ID | 454a9da9-0bd9-49ce-adb7-a53adef46146 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Alcohols and polyols > Secondary alcohols |
IUPAC Name | (2R)-N-[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-2-hydroxytetracosanamide |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCCC(C(=O)NC(CO)C(C=CCCCCCCCCCCCCC)O)O |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCC[C@H](C(=O)N[C@@H](CO)[C@@H](/C=C/CCCCCCCCCCCCC)O)O |
InChI | InChI=1S/C42H83NO4/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-25-27-29-31-33-35-37-41(46)42(47)43-39(38-44)40(45)36-34-32-30-28-26-24-16-14-12-10-8-6-4-2/h34,36,39-41,44-46H,3-33,35,37-38H2,1-2H3,(H,43,47)/b36-34+/t39-,40+,41+/m0/s1 |
InChI Key | WAYLDHLWVYQNSQ-CFBMXOPXSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C42H83NO4 |
Molecular Weight | 666.10 g/mol |
Exact Mass | 665.63221013 g/mol |
Topological Polar Surface Area (TPSA) | 89.80 Ų |
XlogP | 16.50 |
N-(2'-(R)-hydroxylignoceroyl)-D-erythro-sphingosine |
(2R)-N-[(E,2S,3R)-1,3-dihydroxyoctadec-4-en-2-yl]-2-hydroxytetracosanamide |
CHEMBL2268779 |
PD143373 |
24:0(2R-OH) Ceramide, N-(2'-(R)-hydroxylignoceroyl)-D-erythro-sphingosine, powder |
Tetracosanamide, 2-hydroxy-N-[(1S,2R,3E)-2-hydroxy-1-(hydroxymethyl)-3-heptadecen-1-yl]-, (2R)- |
Tetracosanamide,2-hydroxy-N-[(1S,2R,3E)-2-hydroxy-1-(hydroxymethyl)-3-heptadecen-1-yl]-,(2R)- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.68% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 97.50% | 99.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 97.18% | 97.29% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 96.91% | 92.86% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.87% | 89.63% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 96.50% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.93% | 92.08% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 91.55% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.43% | 96.09% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 90.86% | 91.81% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.11% | 83.82% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 88.97% | 91.24% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 88.91% | 100.00% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.89% | 100.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.68% | 96.95% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 87.30% | 94.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 86.75% | 100.00% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.32% | 89.34% |
CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 85.03% | 92.88% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.98% | 85.94% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.14% | 96.47% |
CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 83.95% | 96.67% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.84% | 91.19% |
CHEMBL2664 | P23526 | Adenosylhomocysteinase | 83.71% | 86.67% |
CHEMBL299 | P17252 | Protein kinase C alpha | 81.06% | 98.03% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.88% | 95.50% |
CHEMBL5261 | Q7L7X3 | Serine/threonine-protein kinase TAO1 | 80.59% | 89.33% |
CHEMBL2885 | P07451 | Carbonic anhydrase III | 80.57% | 87.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.51% | 94.73% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 80.35% | 96.00% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.28% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Munronia pinnata |
PubChem | 76308629 |
LOTUS | LTS0203751 |
wikiData | Q105300535 |