N-(2-methylpropyl)-3-phenylprop-2-enamide
Internal ID | 2cec38f3-a8b5-4727-98b7-b48d99acf750 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Cinnamic acid amides |
IUPAC Name | N-(2-methylpropyl)-3-phenylprop-2-enamide |
SMILES (Canonical) | CC(C)CNC(=O)C=CC1=CC=CC=C1 |
SMILES (Isomeric) | CC(C)CNC(=O)C=CC1=CC=CC=C1 |
InChI | InChI=1S/C13H17NO/c1-11(2)10-14-13(15)9-8-12-6-4-3-5-7-12/h3-9,11H,10H2,1-2H3,(H,14,15) |
InChI Key | LNXFPTPVIMNAOD-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H17NO |
Molecular Weight | 203.28 g/mol |
Exact Mass | 203.131014166 g/mol |
Topological Polar Surface Area (TPSA) | 29.10 Ų |
XlogP | 3.00 |
NCIOpen2_002880 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 97.21% | 98.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.34% | 96.00% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.87% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.55% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.13% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.04% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.30% | 94.73% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.21% | 86.33% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.38% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 83.62% | 97.50% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.47% | 93.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.85% | 90.00% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.04% | 90.24% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.86% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piper amalago |
PubChem | 247993 |
LOTUS | LTS0023268 |
wikiData | Q105154561 |