N-[2-(3,4-dimethoxyphenyl)-2-methoxyethyl]benzamide
| Internal ID | fe645176-eb6e-4edb-aa92-749fe1e24e17 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Methoxybenzenes > Dimethoxybenzenes |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)-2-methoxyethyl]benzamide |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C(CNC(=O)C2=CC=CC=C2)OC)OC |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C(CNC(=O)C2=CC=CC=C2)OC)OC |
| InChI | InChI=1S/C18H21NO4/c1-21-15-10-9-14(11-16(15)22-2)17(23-3)12-19-18(20)13-7-5-4-6-8-13/h4-11,17H,12H2,1-3H3,(H,19,20) |
| InChI Key | QWKLDNBJGNJEBU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.14705815 g/mol |
| Topological Polar Surface Area (TPSA) | 56.80 Ų |
| XlogP | 2.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1255126 | O15151 | Protein Mdm4 | 97.50% | 90.20% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.62% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.34% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.57% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.29% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.21% | 96.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 89.48% | 90.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.79% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.70% | 95.56% |
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 87.71% | 87.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.58% | 86.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 86.19% | 81.11% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 84.14% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.03% | 91.07% |
| CHEMBL5701 | Q9H2K8 | Serine/threonine-protein kinase TAO3 | 82.79% | 96.67% |
| CHEMBL5028 | O14672 | ADAM10 | 81.49% | 97.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Zanthoxylum fagara |
| PubChem | 162918611 |
| LOTUS | LTS0129746 |
| wikiData | Q105229238 |