N-[(1R,2R,13S,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-11-yl]acetamide
| Internal ID | fe1f8d58-4ec2-4d54-baf1-f1d004bb8a05 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | N-[(1R,2R,13S,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-11-yl]acetamide |
| SMILES (Canonical) | CC1CC2CC(=C3CCCN4C3(C1)C2CCC4)NC(=O)C |
| SMILES (Isomeric) | C[C@@H]1C[C@H]2CC(=C3CCCN4[C@]3(C1)[C@@H]2CCC4)NC(=O)C |
| InChI | InChI=1S/C18H28N2O/c1-12-9-14-10-17(19-13(2)21)16-6-4-8-20-7-3-5-15(14)18(16,20)11-12/h12,14-15H,3-11H2,1-2H3,(H,19,21)/t12-,14+,15-,18-/m1/s1 |
| InChI Key | QLRULOBLOJIFRC-MJXUCMMTSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.220163521 g/mol |
| Topological Polar Surface Area (TPSA) | 32.30 Ų |
| XlogP | 2.10 |
| There are no found synonyms. |
![2D Structure of N-[(1R,2R,13S,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-11-yl]acetamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-1r2r13s15r-15-methyl-6-azatetracyclo8600160213hexadec-10-en-11-ylacetamide.jpg "2D Structure of N-[(1R,2R,13S,15R)-15-methyl-6-azatetracyclo[8.6.0.01,6.02,13]hexadec-10-en-11-yl]acetamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.36% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.81% | 96.09% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.23% | 91.19% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 88.51% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.76% | 97.09% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 87.50% | 95.58% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.28% | 97.25% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 86.95% | 95.62% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 86.48% | 94.33% |
| CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 86.19% | 96.38% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.75% | 93.04% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.19% | 99.23% |
| CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 84.05% | 97.50% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.83% | 95.89% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.45% | 91.11% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.33% | 92.94% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 82.09% | 91.49% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.34% | 100.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 80.14% | 91.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Huperzia lucidula |
| Lycopodium deuterodensum |
| PubChem | 101289809 |
| LOTUS | LTS0219323 |
| wikiData | Q105223749 |