N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbut-2-enamide
| Internal ID | 6441333d-fed1-4436-a108-f9dde60b8fb6 |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrimidines and pyrimidine derivatives > Hydroxypyrimidines |
| IUPAC Name | N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbut-2-enamide |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H21N3O4/c1-9(2)8-13(20)16-12-6-7-18(15(21)17-12)14-5-4-11(19)10(3)22-14/h6-8,10-11,14,19H,4-5H2,1-3H3,(H,16,17,20,21) |
| InChI Key | IHFHNBHVDHHAQP-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.15320616 g/mol |
| Topological Polar Surface Area (TPSA) | 91.20 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
![2D Structure of N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbut-2-enamide](https://plantaedb.com/storage/docs/compounds/2023/11/n-1-5-hydroxy-6-methyloxan-2-yl-2-oxopyrimidin-4-yl-3-methylbut-2-enamide.jpg "2D Structure of N-[1-(5-hydroxy-6-methyloxan-2-yl)-2-oxopyrimidin-4-yl]-3-methylbut-2-enamide")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.71% | 85.14% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.70% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.72% | 83.82% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.97% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.16% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.86% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.65% | 96.09% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.60% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.77% | 86.33% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.05% | 91.11% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 82.17% | 81.11% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 81.89% | 96.39% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 81.83% | 94.42% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 80.22% | 93.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Haemanthus coccineus |
| Lycoris squamigera |
| Scadoxus multiflorus subsp. multiflorus |
| PubChem | 163061909 |
| LOTUS | LTS0132664 |
| wikiData | Q105166326 |