myricetin 3-O-alpha-D-glucopyranoside
Internal ID | e75d7a23-f85b-42a9-a12a-8b87b5833f90 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid O-glycosides > Flavonoid-3-O-glycosides |
IUPAC Name | 5,7-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
SMILES (Canonical) | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)CO)O)O)O |
SMILES (Isomeric) | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O |
InChI | InChI=1S/C21H20O13/c22-5-12-15(28)17(30)18(31)21(33-12)34-20-16(29)13-8(24)3-7(23)4-11(13)32-19(20)6-1-9(25)14(27)10(26)2-6/h1-4,12,15,17-18,21-28,30-31H,5H2/t12-,15-,17+,18-,21-/m1/s1 |
InChI Key | FOHXFLPXBUAOJM-QUCXHVEGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H20O13 |
Molecular Weight | 480.40 g/mol |
Exact Mass | 480.09039069 g/mol |
Topological Polar Surface Area (TPSA) | 227.00 Ų |
XlogP | 0.00 |
SCHEMBL345349 |
CHEBI:75823 |
Q27145573 |
5,7-dihydroxy-4-oxo-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl alpha-D-glucopyranoside |
5,7-dihydroxy-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.73% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.54% | 89.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 96.15% | 95.64% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.25% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.15% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.26% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.98% | 99.17% |
CHEMBL3194 | P02766 | Transthyretin | 90.79% | 90.71% |
CHEMBL2424 | Q04760 | Glyoxalase I | 88.16% | 91.67% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.09% | 99.15% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.04% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.22% | 95.56% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.21% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.09% | 97.09% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 81.48% | 80.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.41% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Embelia keniensis |
Euphorbia petiolata |
Loropetalum chinense |
Nelumbo nucifera |
PubChem | 10299455 |
LOTUS | LTS0190797 |
wikiData | Q27145573 |