Myriceric acid B
Internal ID | 4ec088ef-5a14-45c6-8d01-42e57d59cce4 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | (4aS,6aR,6aR,6bR,8aR,10S,12aR,14bS)-6a-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)O)C)C)C2C1)COC(=O)C=CC6=CC(=C(C=C6)O)O)C(=O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)COC(=O)/C=C/C6=CC(=C(C=C6)O)O)C)(C)C)O |
InChI | InChI=1S/C39H54O7/c1-34(2)17-18-38(33(44)45)19-20-39(23-46-32(43)12-8-24-7-10-27(40)28(41)21-24)25(26(38)22-34)9-11-30-36(5)15-14-31(42)35(3,4)29(36)13-16-37(30,39)6/h7-10,12,21,26,29-31,40-42H,11,13-20,22-23H2,1-6H3,(H,44,45)/b12-8+/t26-,29-,30+,31-,36-,37+,38-,39-/m0/s1 |
InChI Key | IZCSLJUDQLFLNO-YYGQYJBBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C39H54O7 |
Molecular Weight | 634.80 g/mol |
Exact Mass | 634.38695406 g/mol |
Topological Polar Surface Area (TPSA) | 124.00 Ų |
XlogP | 8.00 |
55497-79-5 |
(4aS,6aR,6aR,6bR,8aR,10S,12aR,14bS)-6a-[[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxymethyl]-10-hydroxy-2,2,6b,9,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
HY-N3222 |
AKOS032948802 |
FS-10009 |
CS-0023632 |
Olean-12-en-28-oic acid, 27-[[3-(3,4-dihydroxyphenyl)-1-oxo-2-propenyl]oxy]-3-hydroxy-, [3,27(E)]-; (3)-27-[[(2E)-3-(3,4-Dihydroxyphenyl)-1-oxo-2-propen-1-yl]oxy]-3-hydroxyolean-12-en-28-oic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.38% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 96.58% | 90.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 96.30% | 95.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.08% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.37% | 97.09% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.24% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.62% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.30% | 94.45% |
CHEMBL2179 | P04062 | Beta-glucocerebrosidase | 87.66% | 85.31% |
CHEMBL2581 | P07339 | Cathepsin D | 87.61% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.71% | 89.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.73% | 95.89% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.97% | 99.15% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 83.63% | 91.49% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.53% | 100.00% |
CHEMBL5028 | O14672 | ADAM10 | 82.23% | 97.50% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.20% | 91.71% |
CHEMBL3194 | P02766 | Transthyretin | 81.71% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Hibiscus taiwanensis |
Rhoiptelea chiliantha |
PubChem | 15767724 |
LOTUS | LTS0184485 |
wikiData | Q105123120 |