Myricananin A
Internal ID | 2f00baba-84d7-4d0a-89b8-b4682b6e1720 |
Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Cyclic diarylheptanoids > Meta,meta-bridged biphenyls |
IUPAC Name | (8S,9S)-16-methoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaene-3,8,9,17-tetrol |
SMILES (Canonical) | COC1=CC2=CC(=C1O)C3=C(C=CC(=C3)CC(C(CCCC2)O)O)O |
SMILES (Isomeric) | COC1=CC2=CC(=C1O)C3=C(C=CC(=C3)C[C@@H]([C@H](CCCC2)O)O)O |
InChI | InChI=1S/C20H24O5/c1-25-19-11-12-4-2-3-5-17(22)18(23)10-13-6-7-16(21)14(8-13)15(9-12)20(19)24/h6-9,11,17-18,21-24H,2-5,10H2,1H3/t17-,18-/m0/s1 |
InChI Key | ZABHYVQENRBSDL-ROUUACIJSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C20H24O5 |
Molecular Weight | 344.40 g/mol |
Exact Mass | 344.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 90.20 Ų |
XlogP | 3.10 |
(8S,9S)-16-methoxytricyclo[12.3.1.12,6]nonadeca-1(17),2,4,6(19),14(18),15-hexaene-3,8,9,17-tetrol |
CHEMBL490837 |
SCHEMBL16488701 |
HY-N3226 |
AKOS032962412 |
CS-0023641 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.78% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.04% | 96.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 95.47% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 94.08% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.77% | 95.89% |
CHEMBL2535 | P11166 | Glucose transporter | 89.29% | 98.75% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 87.47% | 88.48% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 87.33% | 92.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.25% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 86.58% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.01% | 86.33% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.51% | 97.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.28% | 96.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.87% | 99.15% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 82.16% | 97.05% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.97% | 89.62% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.55% | 90.71% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 80.27% | 91.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.12% | 89.00% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 80.03% | 91.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Myrica nana |
PubChem | 25141365 |
NPASS | NPC143483 |
ChEMBL | CHEMBL490837 |
LOTUS | LTS0072231 |
wikiData | Q105369711 |