Muscarine
| Internal ID | 8d0c4bbc-f903-406c-a414-d3c7cc7ae8a1 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Monosaccharides > Pentoses |
| IUPAC Name | [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
| SMILES (Canonical) | CC1C(CC(O1)C[N+](C)(C)C)O |
| SMILES (Isomeric) | C[C@H]1[C@@H](C[C@H](O1)C[N+](C)(C)C)O |
| InChI | InChI=1S/C9H20NO2/c1-7-9(11)5-8(12-7)6-10(2,3)4/h7-9,11H,5-6H2,1-4H3/q+1/t7-,8-,9+/m0/s1 |
| InChI Key | UQOFGTXDASPNLL-XHNCKOQMSA-N |
| Popularity | 969 references in papers |
| Molecular Formula | C9H20NO2+ |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.149403881 g/mol |
| Topological Polar Surface Area (TPSA) | 29.50 Ų |
| XlogP | 0.10 |
| Muscarin |
| L-(+)-Muscarine |
| 300-54-9 |
| Muskarin |
| Muscarine (alkaloid) |
| Muscarine (the alkaloid) |
| (+)-(2S,4R,5S)-Muscarine |
| 7T101UWZ5W |
| 2-Furanmethanaminium, tetrahydro-4-hydroxy-N,N,N,5-tetramethyl-, (2S-(2alpha,4beta,5alpha))- |
| [(2S,4R,5S)-4-hydroxy-5-methyloxolan-2-yl]methyl-trimethylazanium |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 |
56 nM 18197.01 nM 56 nM |
Ki Ki Ki |
PMID: 10891110
PMID: 18182302 via Super-PRED |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 |
449 nM 3900 nM 25 nM |
IC50 IC50 Ki |
PMID: 9622546
PMID: 9622546 via Super-PRED |
| CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 |
1400 nM 23 nM 23 nM |
Ki Ki Ki |
PMID: 10891110
PMID: 10891110 via Super-PRED |
| CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
7943.3 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.81% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.90% | 97.25% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 88.86% | 96.95% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 88.23% | 95.93% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.20% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cannabis sativa |
| PubChem | 9308 |
| NPASS | NPC293551 |
| ChEMBL | CHEMBL12587 |
| LOTUS | LTS0273941 |
| wikiData | Q407952 |