Murucin 1
Internal ID | 94652121-1dbc-4f72-8a40-444e2c10217f |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4R,5R,6S)-5-[(2S,3R,4R,5R,6S)-5-acetyloxy-4-hydroxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-4-hydroxy-6-methyl-2-[[(1R,5S,6R,7R,8R,22R,24R,25S,26S)-7,25,26-trihydroxy-5,24-dimethyl-10-oxo-20-pentyl-2,4,9,21,23-pentaoxatricyclo[20.4.0.03,8]hexacosan-6-yl]oxy]oxan-3-yl] dodecanoate |
SMILES (Canonical) | CCCCCCCCCCCC(=O)OC1C(C(C(OC1OC2C(OC3C(C2O)OC(=O)CCCCCCCCCC(OC4C(O3)C(C(C(O4)C)O)O)CCCCC)C)C)OC5C(C(C(C(O5)C)OC(=O)C)O)OC6C(C(C(C(O6)CO)O)O)O)O |
SMILES (Isomeric) | CCCCCCCCCCCC(=O)O[C@@H]1[C@@H]([C@H]([C@@H](O[C@H]1O[C@H]2[C@@H](OC3[C@@H]([C@@H]2O)OC(=O)CCCCCCCCCC(O[C@H]4[C@H](O3)[C@H]([C@@H]([C@H](O4)C)O)O)CCCCC)C)C)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC(=O)C)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O |
InChI | InChI=1S/C60H104O25/c1-8-10-12-13-14-15-18-21-25-29-39(63)80-53-47(71)51(83-60-55(46(70)49(33(4)74-60)77-36(7)62)84-56-45(69)43(67)42(66)38(31-61)79-56)34(5)75-58(53)82-50-35(6)76-59-54(48(50)72)81-40(64)30-26-22-19-16-17-20-24-28-37(27-23-11-9-2)78-57-52(85-59)44(68)41(65)32(3)73-57/h32-35,37-38,41-61,65-72H,8-31H2,1-7H3/t32-,33+,34+,35+,37?,38-,41-,42-,43+,44+,45-,46-,47-,48-,49+,50+,51+,52-,53-,54-,55-,56+,57+,58+,59?,60+/m1/s1 |
InChI Key | TUDUJRAYAQOSHP-NRAIBJJHSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C60H104O25 |
Molecular Weight | 1225.50 g/mol |
Exact Mass | 1224.68666880 g/mol |
Topological Polar Surface Area (TPSA) | 353.00 Ų |
XlogP | 6.30 |
CHEMBL500201 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.04% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.47% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.45% | 92.50% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.38% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.99% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.86% | 100.00% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 93.03% | 97.36% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.59% | 89.00% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 90.37% | 95.50% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.99% | 97.79% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.72% | 93.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.04% | 97.25% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.46% | 86.33% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.40% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 86.14% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 85.99% | 92.62% |
CHEMBL220 | P22303 | Acetylcholinesterase | 83.93% | 94.45% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.93% | 94.33% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 83.31% | 90.24% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.74% | 95.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.66% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.05% | 100.00% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 82.01% | 92.86% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 81.96% | 82.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.68% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.67% | 96.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 81.57% | 90.08% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.47% | 93.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.00% | 99.23% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 80.98% | 96.61% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 80.15% | 92.08% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea murucoides |
PubChem | 44559236 |
LOTUS | LTS0215203 |
wikiData | Q105264679 |