Murraxocin
| Internal ID | f9681db5-dab6-494f-b1a9-193d67db6a7e |
| Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
| IUPAC Name | 8-(1-ethoxy-2-hydroxy-3-methylbut-3-enyl)-7-methoxychromen-2-one |
| SMILES (Canonical) | CCOC(C1=C(C=CC2=C1OC(=O)C=C2)OC)C(C(=C)C)O |
| SMILES (Isomeric) | CCOC(C1=C(C=CC2=C1OC(=O)C=C2)OC)C(C(=C)C)O |
| InChI | InChI=1S/C17H20O5/c1-5-21-17(15(19)10(2)3)14-12(20-4)8-6-11-7-9-13(18)22-16(11)14/h6-9,15,17,19H,2,5H2,1,3-4H3 |
| InChI Key | GDLSTIJVZWVVPB-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 65.00 Ų |
| XlogP | 2.60 |
| 88478-44-8 |
| 113349-35-2 |
| Murpanicin |
| 8-(1-ethoxy-2-hydroxy-3-methylbut-3-enyl)-7-methoxychromen-2-one |
| NSC684435 |
| 8-(1-ethoxy-2-hydroxy-3-methyl-but-3-enyl)-7-methoxy-chromen-2-one |
| 8-(1-Ethoxy-2-hydroxy-3-methyl-3-butenyl)-7-methoxy-2H-chromen-2-one |
| CHEMBL3426682 |
| DTXSID20921046 |
| AKOS032962156 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 93.40% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.76% | 85.14% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.69% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.50% | 96.09% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 89.34% | 97.21% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.35% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.59% | 94.45% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.05% | 86.33% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.97% | 96.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.74% | 99.17% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.90% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.57% | 95.56% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.13% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.47% | 99.23% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 80.18% | 83.82% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.13% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Murraya alata |
| Murraya paniculata |
| Murraya paniculata |
| PubChem | 188750 |
| NPASS | NPC38099 |
| ChEMBL | CHEMBL3426682 |
| LOTUS | LTS0205741 |
| wikiData | Q82893779 |