Mubenin B
Internal ID | 07c00661-5cff-4365-8f65-7cdd69957864 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | 10-[3,4-dihydroxy-5-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyoxan-2-yl]oxy-2,2,6a,6b,9,9,12a-heptamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2COC(C(C2O)O)OC3CCC4(C(C3(C)C)CCC5(C4CC=C6C5(CCC7(C6CC(CC7)(C)C)C(=O)O)C)C)C)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2COC(C(C2O)O)OC3CCC4(C(C3(C)C)CCC5(C4CC=C6C5(CCC7(C6CC(CC7)(C)C)C(=O)O)C)C)C)O)O)O |
InChI | InChI=1S/C41H66O11/c1-21-28(42)30(44)32(46)34(50-21)51-24-20-49-33(31(45)29(24)43)52-27-12-13-38(6)25(37(27,4)5)11-14-40(8)26(38)10-9-22-23-19-36(2,3)15-17-41(23,35(47)48)18-16-39(22,40)7/h9,21,23-34,42-46H,10-20H2,1-8H3,(H,47,48) |
InChI Key | AHIONNAGCSGVAB-UHFFFAOYSA-N |
Popularity | 4 references in papers |
Molecular Formula | C41H66O11 |
Molecular Weight | 735.00 g/mol |
Exact Mass | 734.46051292 g/mol |
Topological Polar Surface Area (TPSA) | 175.00 Ų |
XlogP | 4.90 |
Raddeanin B |
Mubenin B |
DTXSID101122426 |
(3beta)-3-[[4-O-(6-Deoxy-alpha-L-mannopyranosyl)-alpha-L-arabinopyranosyl]oxy]olean-12-en-28-oic acid |
35790-94-4 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.02% | 91.11% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.53% | 90.17% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 93.93% | 95.17% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 92.84% | 97.36% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.89% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.62% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.59% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.51% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.25% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.47% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 84.84% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.91% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.50% | 99.23% |
CHEMBL5028 | O14672 | ADAM10 | 82.25% | 97.50% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.23% | 92.94% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.99% | 95.89% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.66% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Stauntonia hexaphylla |
PubChem | 73981674 |
LOTUS | LTS0105790 |
wikiData | Q104912248 |