Moudanpioside F
Internal ID | ecb254c6-d7be-4d90-9b86-59aed855e651 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | (1R,5S,6R)-6-(hydroxymethyl)-4,6-dimethyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybicyclo[3.1.1]hept-3-en-2-one |
SMILES (Canonical) | CC1=CC(=O)C2CC1(C2(C)CO)OC3C(C(C(C(O3)CO)O)O)O |
SMILES (Isomeric) | CC1=CC(=O)[C@@H]2C[C@]1([C@@]2(C)CO)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
InChI | InChI=1S/C16H24O8/c1-7-3-9(19)8-4-16(7,15(8,2)6-18)24-14-13(22)12(21)11(20)10(5-17)23-14/h3,8,10-14,17-18,20-22H,4-6H2,1-2H3/t8-,10+,11+,12-,13+,14-,15-,16-/m0/s1 |
InChI Key | HDRABVWFLVVWRI-VCRUDBCKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C16H24O8 |
Molecular Weight | 344.36 g/mol |
Exact Mass | 344.14711772 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | -2.30 |
Mudanpioside F |
CHEMBL2205293 |
![2D Structure of Moudanpioside F 2D Structure of Moudanpioside F](https://plantaedb.com/storage/docs/compounds/2023/07/moudanpioside-f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.22% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.84% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.95% | 97.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.30% | 95.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 89.69% | 97.36% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.33% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 86.76% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.41% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.17% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.00% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.69% | 94.73% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.52% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.45% | 90.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.34% | 86.92% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.71% | 94.75% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.17% | 91.49% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Paeonia anomala subsp. veitchii |
Paeonia obovata |
Paeonia suffruticosa |
PubChem | 21631108 |
NPASS | NPC151516 |
ChEMBL | CHEMBL2205293 |
LOTUS | LTS0134788 |
wikiData | Q105026492 |