Mmnoqhdxbasuhg-srwgnfdisa-
| Internal ID | a61bf88b-cd61-41f7-b19b-70efc67f7c45 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Tricarboxylic acids and derivatives |
| IUPAC Name | [(1R)-1-[(1aS,4S,4aS,8S,8aR)-4-(furan-3-yl)-4a,8-dimethyl-2-oxo-4,5-dihydro-1aH-oxireno[2,3-d]isochromen-8-yl]-2-(6,6-dimethyl-2-oxo-3H-pyran-5-yl)ethyl] acetate |
| SMILES (Canonical) | CC(=O)OC(CC1=CCC(=O)OC1(C)C)C2(C=CCC3(C24C(O4)C(=O)OC3C5=COC=C5)C)C |
| SMILES (Isomeric) | CC(=O)O[C@H](CC1=CCC(=O)OC1(C)C)[C@@]2(C=CC[C@@]3([C@]24[C@H](O4)C(=O)O[C@H]3C5=COC=C5)C)C |
| InChI | InChI=1S/C26H30O8/c1-15(27)31-18(13-17-7-8-19(28)33-23(17,2)3)24(4)10-6-11-25(5)20(16-9-12-30-14-16)32-22(29)21-26(24,25)34-21/h6-7,9-10,12,14,18,20-21H,8,11,13H2,1-5H3/t18-,20+,21-,24+,25+,26+/m1/s1 |
| InChI Key | MMNOQHDXBASUHG-SRWGNFDISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19406791 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 2.80 |
| InChI=1/C26H30O8/c1-15(27)31-18(13-17-7-8-19(28)33-23(17,2)3)24(4)10-6-11-25(5)20(16-9-12-30-14-16)32-22(29)21-26(24,25)34-21/h6-7,9-10,12,14,18,20-21H,8,11,13H2,1-5H3/t18-,20+,21-,24+,25+,26+/m1/s1 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.68% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.58% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 97.55% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.15% | 98.95% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.36% | 89.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.05% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.29% | 94.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.24% | 94.73% |
| CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 82.48% | 95.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.21% | 86.33% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.03% | 97.25% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 80.44% | 98.59% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.44% | 95.89% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.32% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Carapa procera |
| PubChem | 21673291 |
| LOTUS | LTS0131025 |
| wikiData | Q105167918 |