Mikanin
Internal ID | bc1be843-66c5-49c0-8a8a-c51a4c30b9b9 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > Flavonols |
IUPAC Name | 3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
SMILES (Canonical) | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O |
SMILES (Isomeric) | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O |
InChI | InChI=1S/C18H16O7/c1-22-10-6-4-9(5-7-10)17-16(21)14(19)13-11(25-17)8-12(23-2)18(24-3)15(13)20/h4-8,20-21H,1-3H3 |
InChI Key | SGCYGSKAUSOJND-UHFFFAOYSA-N |
Popularity | 18 references in papers |
Molecular Formula | C18H16O7 |
Molecular Weight | 344.30 g/mol |
Exact Mass | 344.08960285 g/mol |
Topological Polar Surface Area (TPSA) | 94.40 Ų |
XlogP | 3.10 |
4324-53-2 |
6-Hydroxy-6,7,4'-trimethylkaempferol |
3,5-Dihydroxy-4',6,7-trimethoxyflavone |
3,5-dihydroxy-6,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
CHEMBL554063 |
LMPK12112876 |
AKOS040762729 |
![2D Structure of Mikanin 2D Structure of Mikanin](https://plantaedb.com/storage/docs/compounds/2023/07/mikanin.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.38% | 91.11% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.54% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.92% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.89% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.54% | 86.33% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.73% | 99.15% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.59% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.63% | 99.17% |
CHEMBL2581 | P07339 | Cathepsin D | 88.45% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.11% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.05% | 94.45% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.77% | 90.00% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 83.81% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.10% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.52% | 95.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 80.47% | 86.92% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.43% | 94.42% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cassinia laevis |
Cyanthillium cinereum |
Helianthus microcephalus |
Mikania micrantha |
Salvia candidissima |
Zanthoxylum bungeanum |
PubChem | 15560536 |
NPASS | NPC49824 |
ChEMBL | CHEMBL554063 |
LOTUS | LTS0124917 |
wikiData | Q104397257 |