Micromarin F
Internal ID | a6be02af-5c34-4b68-bda3-6524d2dec649 |
Taxonomy | Phenylpropanoids and polyketides > Coumarins and derivatives |
IUPAC Name | 8-[(E)-4-hydroxy-3-methylbut-2-enyl]-7-methoxychromen-2-one |
SMILES (Canonical) | CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)OC)CO |
SMILES (Isomeric) | C/C(=C\CC1=C(C=CC2=C1OC(=O)C=C2)OC)/CO |
InChI | InChI=1S/C15H16O4/c1-10(9-16)3-6-12-13(18-2)7-4-11-5-8-14(17)19-15(11)12/h3-5,7-8,16H,6,9H2,1-2H3/b10-3+ |
InChI Key | NYBDJZVNEBTWCZ-XCVCLJGOSA-N |
Popularity | 2 references in papers |
Molecular Formula | C15H16O4 |
Molecular Weight | 260.28 g/mol |
Exact Mass | 260.10485899 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 2.60 |
8-(4-Hydroxy-3-methylbut-2-en-1-yl)-7-methoxy-2H-chromen-2-one |
1443627-08-4 |
HY-N12278 |
AKOS040763837 |
CS-0897240 |
73292-93-0 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.85% | 90.20% |
CHEMBL2581 | P07339 | Cathepsin D | 90.41% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.85% | 94.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.94% | 95.56% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.24% | 96.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 85.21% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.99% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.64% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 84.19% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.35% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.42% | 99.23% |
CHEMBL2535 | P11166 | Glucose transporter | 81.94% | 98.75% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.77% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Micromelum minutum |
PubChem | 10730037 |
LOTUS | LTS0128872 |
wikiData | Q105187431 |