methyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate
Internal ID | fce1495f-db04-4fb2-b7a8-b211f70abc10 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
IUPAC Name | methyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate |
SMILES (Canonical) | CC1=C(C2(CCCC(C2CC1=O)(C)C)C)CCC(C)CC(=O)OC |
SMILES (Isomeric) | CC1=C(C2(CCCC(C2CC1=O)(C)C)C)CCC(C)CC(=O)OC |
InChI | InChI=1S/C21H34O3/c1-14(12-19(23)24-6)8-9-16-15(2)17(22)13-18-20(3,4)10-7-11-21(16,18)5/h14,18H,7-13H2,1-6H3 |
InChI Key | FZYQQUFRUMLHHQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H34O3 |
Molecular Weight | 334.50 g/mol |
Exact Mass | 334.25079494 g/mol |
Topological Polar Surface Area (TPSA) | 43.40 Ų |
XlogP | 5.10 |
There are no found synonyms. |
![2D Structure of methyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate 2D Structure of methyl 5-(2,5,5,8a-tetramethyl-3-oxo-4a,6,7,8-tetrahydro-4H-naphthalen-1-yl)-3-methylpentanoate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-5-2558a-tetramethyl-3-oxo-4a678-tetrahydro-4h-naphthalen-1-yl-3-methylpentanoate.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.79% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.93% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.46% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.20% | 94.45% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.32% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 92.78% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 91.74% | 85.14% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.63% | 90.71% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 88.04% | 94.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.98% | 82.69% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.69% | 93.56% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.27% | 91.07% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.88% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 83.36% | 94.33% |
CHEMBL5028 | O14672 | ADAM10 | 81.36% | 97.50% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.29% | 97.09% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.05% | 100.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cistus ladanifer |
PubChem | 162884824 |
LOTUS | LTS0095370 |
wikiData | Q105005250 |