methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate
| Internal ID | 19269ace-c18e-42d4-99cc-a2f5553a44b6 |
| Taxonomy | Alkaloids and derivatives > Harmala alkaloids |
| IUPAC Name | methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H12N2O3/c1-18-10-7-15-13(14(17)19-2)12-11(10)8-5-3-4-6-9(8)16-12/h3-7,16H,1-2H3 |
| InChI Key | WNNUGSXDGKSRRG-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08479225 g/mol |
| Topological Polar Surface Area (TPSA) | 64.20 Ų |
| XlogP | 2.50 |
| 4-Methoxy-1-methoxycarbonyl-beta-carboline |
| methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate |
| 4-Methoxy-|A-carboline-1-carboxylic acid methylester |
| 9H-Pyrido[3,4-b]indole-1-carboxylic acid,4-methoxy-, methyl ester |
| orb1680732 |
| DTXSID70976283 |
| HY-N1905 |
| KCA80725 |
| 9H-Pyrido(3,4-b)indole-1-carboxylic acid, 4-methoxy-, methyl ester |
| AKOS022184881 |
| There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/methyl-4-methoxy-9h-pyrido34-bindole-1-carboxylate.jpg "2D Structure of methyl 4-methoxy-9H-pyrido[3,4-b]indole-1-carboxylate")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.85% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 93.75% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.59% | 85.14% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.67% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.73% | 94.45% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.76% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.41% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.38% | 99.17% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.61% | 99.23% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 86.53% | 95.56% |
| CHEMBL1287628 | Q9Y5S8 | NADPH oxidase 1 | 86.15% | 95.48% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.93% | 93.99% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.98% | 96.00% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 83.55% | 89.44% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.43% | 97.00% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 82.19% | 98.59% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 82.07% | 92.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 82.00% | 86.33% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Ailanthus altissima |
| PubChem | 181292 |
| LOTUS | LTS0079296 |
| wikiData | Q72490193 |