Methyl 12-hydroxyoctadecanoate
| Internal ID | 5a12636a-e974-47ad-8d64-6a50b7f83aba |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | methyl 12-hydroxyoctadecanoate |
| SMILES (Canonical) | CCCCCCC(CCCCCCCCCCC(=O)OC)O |
| SMILES (Isomeric) | CCCCCCC(CCCCCCCCCCC(=O)OC)O |
| InChI | InChI=1S/C19H38O3/c1-3-4-5-12-15-18(20)16-13-10-8-6-7-9-11-14-17-19(21)22-2/h18,20H,3-17H2,1-2H3 |
| InChI Key | RVWOWEQKPMPWMQ-UHFFFAOYSA-N |
| Popularity | 108 references in papers |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.28209507 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 6.60 |
| Atomic LogP (AlogP) | 5.39 |
| H-Bond Acceptor | 3 |
| H-Bond Donor | 1 |
| Rotatable Bonds | 16 |
| METHYL 12-HYDROXYSTEARATE |
| 141-23-1 |
| Kemester 1288 |
| Methyl hydroxystearate |
| Octadecanoic acid, 12-hydroxy-, methyl ester |
| 12-Hydroxystearic acid, methyl ester |
| Methyl-12-hydroxystearate |
| NSC 2392 |
| 12-Hydroxystearic acid methyl ester |
| Paracin 1 |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.9882 | 98.82% |
| Caco-2 | + | 0.7002 | 70.02% |
| Blood Brain Barrier | + | 0.8000 | 80.00% |
| Human oral bioavailability | - | 0.6571 | 65.71% |
| Subcellular localzation | Mitochondria | 0.8037 | 80.37% |
| OATP2B1 inhibitior | - | 0.8484 | 84.84% |
| OATP1B1 inhibitior | + | 0.9452 | 94.52% |
| OATP1B3 inhibitior | + | 0.8702 | 87.02% |
| MATE1 inhibitior | - | 0.9200 | 92.00% |
| OCT2 inhibitior | - | 0.7500 | 75.00% |
| BSEP inhibitior | - | 0.4552 | 45.52% |
| P-glycoprotein inhibitior | - | 0.8052 | 80.52% |
| P-glycoprotein substrate | - | 0.7940 | 79.40% |
| CYP3A4 substrate | - | 0.5832 | 58.32% |
| CYP2C9 substrate | - | 0.8037 | 80.37% |
| CYP2D6 substrate | - | 0.8433 | 84.33% |
| CYP3A4 inhibition | - | 0.9539 | 95.39% |
| CYP2C9 inhibition | - | 0.8723 | 87.23% |
| CYP2C19 inhibition | - | 0.9405 | 94.05% |
| CYP2D6 inhibition | - | 0.9446 | 94.46% |
| CYP1A2 inhibition | - | 0.6544 | 65.44% |
| CYP2C8 inhibition | - | 0.9412 | 94.12% |
| CYP inhibitory promiscuity | - | 0.9246 | 92.46% |
| UGT catelyzed | - | 0.5000 | 50.00% |
| Carcinogenicity (binary) | - | 0.7315 | 73.15% |
| Carcinogenicity (trinary) | Non-required | 0.7375 | 73.75% |
| Eye corrosion | + | 0.5949 | 59.49% |
| Eye irritation | + | 0.9137 | 91.37% |
| Skin irritation | - | 0.7507 | 75.07% |
| Skin corrosion | - | 0.9340 | 93.40% |
| Ames mutagenesis | - | 0.9700 | 97.00% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.5687 | 56.87% |
| Micronuclear | - | 0.9900 | 99.00% |
| Hepatotoxicity | - | 0.5642 | 56.42% |
| skin sensitisation | + | 0.6886 | 68.86% |
| Respiratory toxicity | - | 0.8667 | 86.67% |
| Reproductive toxicity | - | 0.8052 | 80.52% |
| Mitochondrial toxicity | - | 0.6625 | 66.25% |
| Nephrotoxicity | + | 0.5768 | 57.68% |
| Acute Oral Toxicity (c) | III | 0.6732 | 67.32% |
| Estrogen receptor binding | - | 0.8360 | 83.60% |
| Androgen receptor binding | - | 0.8415 | 84.15% |
| Thyroid receptor binding | - | 0.6172 | 61.72% |
| Glucocorticoid receptor binding | - | 0.6388 | 63.88% |
| Aromatase binding | - | 0.8514 | 85.14% |
| PPAR gamma | + | 0.5318 | 53.18% |
| Honey bee toxicity | - | 0.9752 | 97.52% |
| Biodegradation | + | 0.8250 | 82.50% |
| Crustacea aquatic toxicity | + | 0.6893 | 68.93% |
| Fish aquatic toxicity | + | 0.8392 | 83.92% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.63% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.78% | 99.17% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.62% | 97.29% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.54% | 98.95% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 91.08% | 83.82% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 90.40% | 92.08% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 90.11% | 92.86% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 89.93% | 98.03% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.91% | 95.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.89% | 91.11% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.75% | 100.00% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 87.57% | 85.94% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 86.95% | 93.56% |
| CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 85.73% | 94.33% |
| CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.07% | 100.00% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 84.67% | 91.81% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.37% | 96.95% |
| CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 83.98% | 95.93% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.90% | 94.45% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 83.37% | 89.63% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 83.19% | 100.00% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.09% | 92.50% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.32% | 91.19% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.66% | 96.00% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.53% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Spirodela polyrhiza |