Metformin
| Internal ID | bd9a03a7-7f79-48a4-86c0-9883b6d7e81c |
| Taxonomy | Organic nitrogen compounds > Organonitrogen compounds > Guanidines > Biguanides |
| IUPAC Name | 3-(diaminomethylidene)-1,1-dimethylguanidine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C4H11N5/c1-9(2)4(7)8-3(5)6/h1-2H3,(H5,5,6,7,8) |
| InChI Key | XZWYZXLIPXDOLR-UHFFFAOYSA-N |
| Popularity | 54,719 references in papers |
| Molecular Formula | C4H11N5 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.10144537 g/mol |
| Topological Polar Surface Area (TPSA) | 91.50 Ų |
| XlogP | -1.30 |
| 657-24-9 |
| 1,1-Dimethylbiguanide |
| N,N-dimethylimidodicarbonimidic diamide |
| Metiguanide |
| Dimethylbiguanide |
| Metformine |
| N,N-Dimethylbiguanide |
| Metformina |
| N1,N1-Dimethylbiguanide |
| N,N-Dimethyldiguanide |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| CHEMBL284 | P27487 | Dipeptidyl peptidase IV |
29000 nM |
IC50 |
PMID: 18068977
|
| CHEMBL1293235 | P02545 | Prelamin-A/C |
3.5 nM |
Potency |
via CMAUP
|
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 97.25% | 97.88% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.78% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| PubChem | 4091 |
| NPASS | NPC230775 |
| ChEMBL | CHEMBL1431 |