Mangostinone
Internal ID | 8ce0eba4-550e-441e-9bd2-8d5286fa72e3 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones > 2-prenylated xanthones |
IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5-trihydroxyxanthen-9-one |
SMILES (Canonical) | CC(=CCCC(=CCC1=C(C2=C(C=C1O)OC3=C(C2=O)C=CC=C3O)O)C)C |
SMILES (Isomeric) | CC(=CCC/C(=C/CC1=C(C2=C(C=C1O)OC3=C(C2=O)C=CC=C3O)O)/C)C |
InChI | InChI=1S/C23H24O5/c1-13(2)6-4-7-14(3)10-11-15-18(25)12-19-20(21(15)26)22(27)16-8-5-9-17(24)23(16)28-19/h5-6,8-10,12,24-26H,4,7,11H2,1-3H3/b14-10+ |
InChI Key | RJLWIAOXQDZMTB-GXDHUFHOSA-N |
Popularity | 6 references in papers |
Molecular Formula | C23H24O5 |
Molecular Weight | 380.40 g/mol |
Exact Mass | 380.16237386 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 6.20 |
166197-40-6 |
9H-Xanthen-9-one, 2-[(2E)-3,7-dimethyl-2,6-octadien-1-yl]-1,3,5-trihydroxy- |
CHEMBL481310 |
CHEBI:175012 |
DTXSID301318091 |
2-geranyl-1,3,5-trihydroxyxanthone |
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5-trihydroxyxanthen-9-one |
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1,3,5-trihydroxy-xanthen-9-one |
2-[(2E)-3,7-DIMETHYLOCTA-2,6-DIEN-1-YL]-1,3,5-TRIHYDROXY-9H-XANTHEN-9-ONE |
9H-Xanthen-9-one, 2-[(2E)-3,7-dimethyl-2,6-octadienyl]-1,3,5-trihydroxy- |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.42% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 97.86% | 98.95% |
CHEMBL3401 | O75469 | Pregnane X receptor | 97.53% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.76% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.61% | 89.00% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 93.89% | 92.08% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 93.09% | 91.49% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.03% | 94.45% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 91.31% | 99.23% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.17% | 83.57% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.36% | 86.33% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.27% | 93.99% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.47% | 99.17% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.10% | 94.00% |
CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 83.24% | 83.10% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.43% | 85.14% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.75% | 99.15% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.45% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
PubChem | 6478778 |
NPASS | NPC227337 |
ChEMBL | CHEMBL481310 |
LOTUS | LTS0064756 |
wikiData | Q104399228 |