Magnolone
Internal ID | 2cbd0d7c-36a4-4d18-97ed-1714922c6438 |
Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,9-epoxylignans |
IUPAC Name | [(3S,4R,5S)-5-(1,3-benzodioxol-5-yl)-4-(hydroxymethyl)oxolan-3-yl]-(3,4-dimethoxyphenyl)methanone |
SMILES (Canonical) | COC1=C(C=C(C=C1)C(=O)C2COC(C2CO)C3=CC4=C(C=C3)OCO4)OC |
SMILES (Isomeric) | COC1=C(C=C(C=C1)C(=O)[C@@H]2CO[C@@H]([C@H]2CO)C3=CC4=C(C=C3)OCO4)OC |
InChI | InChI=1S/C21H22O7/c1-24-16-5-3-12(7-18(16)25-2)20(23)15-10-26-21(14(15)9-22)13-4-6-17-19(8-13)28-11-27-17/h3-8,14-15,21-22H,9-11H2,1-2H3/t14-,15+,21+/m0/s1 |
InChI Key | RYPHKZUVFXPUMU-PDSXEYIOSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C21H22O7 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.13655304 g/mol |
Topological Polar Surface Area (TPSA) | 83.40 Ų |
XlogP | 2.10 |
CHEMBL2236570 |
[(3S,4R,5S)-5-(1,3-benzodioxol-5-yl)-4-(hydroxymethyl)oxolan-3-yl]-(3,4-dimethoxyphenyl)methanone |
![2D Structure of Magnolone 2D Structure of Magnolone](https://plantaedb.com/storage/docs/compounds/2023/11/magnolone.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.61% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.57% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.40% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.79% | 99.17% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.61% | 97.09% |
CHEMBL2535 | P11166 | Glucose transporter | 89.46% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.37% | 92.62% |
CHEMBL4145 | Q9UKV0 | Histone deacetylase 9 | 88.25% | 85.49% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.96% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.10% | 96.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.66% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.55% | 90.00% |
CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 84.53% | 89.44% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 84.40% | 91.19% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 84.09% | 94.80% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.70% | 93.99% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 83.18% | 89.67% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.58% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Magnolia coco |
Magnolia denudata |
PubChem | 21668714 |
LOTUS | LTS0239487 |
wikiData | Q104399084 |