Macrophyllicin
Internal ID | 125c7a8b-2902-4b0c-8737-b9b325ce212a |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids |
IUPAC Name | [(5S,6aR,6bS,8S,8aS,12aR,14bR)-5,8-dihydroxy-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl] (2S,3S,4S,5R,6R)-3-hydroxy-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxane-2-carboxylate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)O)O)OC4C(C(C(C(O4)CO)O)O)O)C(=O)OC5CCC6(C7CC=C8C9CC(CCC9(C(CC8(C7(CC(C6C5(C)C)O)C)C)O)CO)(C)C)C)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2[C@@H]([C@H](O[C@@H]([C@@H]2O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O[C@@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O)C(=O)OC5CC[C@@]6(C7CC=C8[C@H]9CC(CC[C@@]9([C@H](C[C@]8([C@@]7(C[C@@H](C6C5(C)C)O)C)C)O)CO)(C)C)C)O)O)O)O |
InChI | InChI=1S/C54H88O24/c1-21-30(60)33(63)36(66)45(71-21)75-40-39(69)41(76-48(78-47-38(68)35(65)32(62)26(19-56)73-47)42(40)77-46-37(67)34(64)31(61)25(18-55)72-46)44(70)74-29-11-12-51(6)27-10-9-22-23-15-49(2,3)13-14-54(23,20-57)28(59)17-52(22,7)53(27,8)16-24(58)43(51)50(29,4)5/h9,21,23-43,45-48,55-69H,10-20H2,1-8H3/t21-,23+,24-,25+,26+,27?,28-,29?,30-,31+,32-,33+,34-,35-,36+,37+,38+,39-,40-,41-,42+,43?,45-,46+,47+,48+,51+,52+,53+,54+/m0/s1 |
InChI Key | CDYAORBMMPRWHL-XOJINRSKSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C54H88O24 |
Molecular Weight | 1121.30 g/mol |
Exact Mass | 1120.56655367 g/mol |
Topological Polar Surface Area (TPSA) | 394.00 Ų |
XlogP | -0.20 |
149474-93-1 |
3-O-(alpha-L-Rhamnopyranosyl(1-2)-beta-D-glucopyranosyl-(1-2)-beta-D-galactopyranosyl-(1-2)-beta-D-glucuronopyranosyl)-6beta,16alpha,28-trihydroxyolean-12-ene |
beta-D-Glucopyranosiduronic acid, (3beta,6beta,16alpha)-6,16,28-trihydroxyolean-12-en-3-yl O-6-deoxy-alpha-L-mannopyranosyl-(1-2)-O-beta-D-glucopyranosyl-(1-2)-O-beta-D-galactopyranosyl-(1-2)- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.39% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.38% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.02% | 94.45% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 92.07% | 95.93% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 91.91% | 96.21% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.85% | 97.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.33% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.30% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 85.68% | 100.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.23% | 94.00% |
CHEMBL2581 | P07339 | Cathepsin D | 85.16% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.59% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.52% | 96.61% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.22% | 92.50% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 82.02% | 97.36% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.84% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.65% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 81.46% | 94.75% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.14% | 97.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.89% | 100.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.29% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Primula macrophylla |
PubChem | 44150651 |
LOTUS | LTS0136580 |
wikiData | Q104955313 |