Lormetazepam
Internal ID | db3aeb82-18bd-4b82-b71c-947dc6a70149 |
Taxonomy | Organoheterocyclic compounds > Benzodiazepines > 1,4-benzodiazepines |
IUPAC Name | 7-chloro-5-(2-chlorophenyl)-3-hydroxy-1-methyl-3H-1,4-benzodiazepin-2-one |
SMILES (Canonical) | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3Cl |
SMILES (Isomeric) | CN1C2=C(C=C(C=C2)Cl)C(=NC(C1=O)O)C3=CC=CC=C3Cl |
InChI | InChI=1S/C16H12Cl2N2O2/c1-20-13-7-6-9(17)8-11(13)14(19-15(21)16(20)22)10-4-2-3-5-12(10)18/h2-8,15,21H,1H3 |
InChI Key | FJIKWRGCXUCUIG-UHFFFAOYSA-N |
Popularity | 1,183 references in papers |
Molecular Formula | C16H12Cl2N2O2 |
Molecular Weight | 335.20 g/mol |
Exact Mass | 334.0275830 g/mol |
Topological Polar Surface Area (TPSA) | 52.90 Ų |
XlogP | 2.40 |
Methyllorazepam |
N-Methyllorazepam |
Noctamid |
Loramet |
848-75-9 |
Lormetazepamum |
Chlorotemazepam |
Ergocalm |
Noctamide |
WY-4082 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.14% | 95.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 94.58% | 82.69% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.91% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 93.33% | 98.95% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.65% | 85.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.26% | 94.73% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 88.35% | 100.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.74% | 96.09% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.90% | 96.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 84.68% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.29% | 94.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.38% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.29% | 96.00% |
CHEMBL2443 | P49862 | Kallikrein 7 | 81.04% | 94.00% |
CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 80.28% | 93.65% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.02% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Solanum tuberosum |
Triticum aestivum |
PubChem | 13314 |
LOTUS | LTS0113904 |
wikiData | Q186257 |