Lophirone E
Internal ID | e78287cb-7e54-4ff1-b70d-ff76fb8eb8cc |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | (E)-1-(2,4-dihydroxyphenyl)-3-[2-(4-hydroxyphenyl)-1-benzofuran-5-yl]prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=CC=C1C2=CC3=C(O2)C=CC(=C3)C=CC(=O)C4=C(C=C(C=C4)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=CC3=C(O2)C=CC(=C3)/C=C/C(=O)C4=C(C=C(C=C4)O)O)O |
InChI | InChI=1S/C23H16O5/c24-17-5-3-15(4-6-17)23-12-16-11-14(2-10-22(16)28-23)1-9-20(26)19-8-7-18(25)13-21(19)27/h1-13,24-25,27H/b9-1+ |
InChI Key | ASHHFRLYDYFCHN-XLUWADSXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H16O5 |
Molecular Weight | 372.40 g/mol |
Exact Mass | 372.09977361 g/mol |
Topological Polar Surface Area (TPSA) | 90.90 Ų |
XlogP | 5.20 |
CHEBI:185765 |
LMPK12120075 |
(E)-1-(2,4-dihydroxyphenyl)-3-[2-(4-hydroxyphenyl)-1-benzouran-5-yl]prop-2-en-1-one |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.54% | 91.11% |
CHEMBL2208 | P49137 | MAP kinase-activated protein kinase 2 | 96.27% | 95.20% |
CHEMBL3194 | P02766 | Transthyretin | 95.45% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.13% | 86.33% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 92.12% | 98.35% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.09% | 89.00% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 91.93% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 89.45% | 98.95% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 88.94% | 99.15% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.74% | 95.50% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.00% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.66% | 95.56% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 84.98% | 91.38% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.59% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.47% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.35% | 99.23% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.69% | 85.14% |
CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 80.66% | 92.29% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.22% | 99.17% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lophira alata |
Lophira lanceolata |
PubChem | 14376454 |
LOTUS | LTS0128115 |
wikiData | Q76423761 |