Lophirone D
Internal ID | 149d9339-7113-404e-8ffa-8e27485a724c |
Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
IUPAC Name | 5-[(E)-3-(2,4-dihydroxyphenyl)-3-oxoprop-1-enyl]-2-(4-hydroxyphenyl)-1-benzofuran-3-carbaldehyde |
SMILES (Canonical) | C1=CC(=CC=C1C2=C(C3=C(O2)C=CC(=C3)C=CC(=O)C4=C(C=C(C=C4)O)O)C=O)O |
SMILES (Isomeric) | C1=CC(=CC=C1C2=C(C3=C(O2)C=CC(=C3)/C=C/C(=O)C4=C(C=C(C=C4)O)O)C=O)O |
InChI | InChI=1S/C24H16O6/c25-13-20-19-11-14(1-9-21(28)18-8-7-17(27)12-22(18)29)2-10-23(19)30-24(20)15-3-5-16(26)6-4-15/h1-13,26-27,29H/b9-1+ |
InChI Key | QTLOYOSKGRNTNQ-XLUWADSXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H16O6 |
Molecular Weight | 400.40 g/mol |
Exact Mass | 400.09468823 g/mol |
Topological Polar Surface Area (TPSA) | 108.00 Ų |
XlogP | 4.70 |
LMPK12120074 |
![2D Structure of Lophirone D 2D Structure of Lophirone D](https://plantaedb.com/storage/docs/compounds/2023/11/lophirone-d.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.19% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 96.20% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 95.12% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.01% | 95.56% |
CHEMBL242 | Q92731 | Estrogen receptor beta | 93.41% | 98.35% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.47% | 91.71% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 91.43% | 98.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.41% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 91.32% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.91% | 86.33% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 88.36% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.34% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.71% | 96.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.10% | 94.73% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.41% | 99.23% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.31% | 90.71% |
CHEMBL206 | P03372 | Estrogen receptor alpha | 81.13% | 97.64% |
CHEMBL3038469 | P24941 | CDK2/Cyclin A | 80.90% | 91.38% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.62% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Lophira alata |
Lophira lanceolata |
PubChem | 14376455 |
LOTUS | LTS0190666 |
wikiData | Q76423763 |