Lopac-I-3766
Internal ID | 3a607276-c07c-470a-aeee-c80fd0e2fe72 |
Taxonomy | Phenylpropanoids and polyketides > Linear 1,3-diarylpropanoids > Chalcones and dihydrochalcones > 2-Hydroxychalcones |
IUPAC Name | (Z)-1-(2,4-dihydroxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)C2=C(C=C(C=C2)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C\C(=O)C2=C(C=C(C=C2)O)O)O |
InChI | InChI=1S/C15H12O4/c16-11-4-1-10(2-5-11)3-8-14(18)13-7-6-12(17)9-15(13)19/h1-9,16-17,19H/b8-3- |
InChI Key | DXDRHHKMWQZJHT-BAQGIRSFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H12O4 |
Molecular Weight | 256.25 g/mol |
Exact Mass | 256.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 77.80 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 2.70 |
H-Bond Acceptor | 4 |
H-Bond Donor | 3 |
Rotatable Bonds | 3 |
CHEMBL1395334 |
NCGC00015556-01 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9856 | 98.56% |
Caco-2 | + | 0.9313 | 93.13% |
Blood Brain Barrier | - | 0.7500 | 75.00% |
Human oral bioavailability | - | 0.5286 | 52.86% |
Subcellular localzation | Mitochondria | 0.7711 | 77.11% |
OATP2B1 inhibitior | - | 0.7039 | 70.39% |
OATP1B1 inhibitior | + | 0.9414 | 94.14% |
OATP1B3 inhibitior | + | 0.9480 | 94.80% |
MATE1 inhibitior | - | 0.7800 | 78.00% |
OCT2 inhibitior | - | 0.9838 | 98.38% |
BSEP inhibitior | - | 0.6574 | 65.74% |
P-glycoprotein inhibitior | - | 0.9385 | 93.85% |
P-glycoprotein substrate | - | 0.9513 | 95.13% |
CYP3A4 substrate | - | 0.6718 | 67.18% |
CYP2C9 substrate | - | 0.6211 | 62.11% |
CYP2D6 substrate | - | 0.8534 | 85.34% |
CYP3A4 inhibition | + | 0.7959 | 79.59% |
CYP2C9 inhibition | + | 0.8949 | 89.49% |
CYP2C19 inhibition | + | 0.8994 | 89.94% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | + | 0.9350 | 93.50% |
CYP2C8 inhibition | + | 0.5638 | 56.38% |
CYP inhibitory promiscuity | + | 0.8559 | 85.59% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.7472 | 74.72% |
Carcinogenicity (trinary) | Non-required | 0.7048 | 70.48% |
Eye corrosion | - | 0.9801 | 98.01% |
Eye irritation | + | 0.9919 | 99.19% |
Skin irritation | + | 0.6928 | 69.28% |
Skin corrosion | - | 0.9313 | 93.13% |
Ames mutagenesis | + | 0.7300 | 73.00% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.8554 | 85.54% |
Micronuclear | + | 0.7500 | 75.00% |
Hepatotoxicity | - | 0.8967 | 89.67% |
skin sensitisation | + | 0.8772 | 87.72% |
Respiratory toxicity | - | 0.7444 | 74.44% |
Reproductive toxicity | + | 0.6222 | 62.22% |
Mitochondrial toxicity | - | 0.7000 | 70.00% |
Nephrotoxicity | - | 0.6477 | 64.77% |
Acute Oral Toxicity (c) | III | 0.7921 | 79.21% |
Estrogen receptor binding | + | 0.9293 | 92.93% |
Androgen receptor binding | + | 0.8927 | 89.27% |
Thyroid receptor binding | + | 0.6737 | 67.37% |
Glucocorticoid receptor binding | + | 0.8590 | 85.90% |
Aromatase binding | + | 0.9380 | 93.80% |
PPAR gamma | + | 0.9077 | 90.77% |
Honey bee toxicity | - | 0.9037 | 90.37% |
Biodegradation | - | 0.9250 | 92.50% |
Crustacea aquatic toxicity | - | 0.7300 | 73.00% |
Fish aquatic toxicity | + | 0.9906 | 99.06% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL1900 | P15121 | Aldose reductase |
320 nM |
IC50 |
via Super-PRED
|
CHEMBL2903 | P16050 | Arachidonate 15-lipoxygenase |
25118.9 nM |
Potency |
via CMAUP
|
CHEMBL4096 | P04637 | Cellular tumor antigen p53 |
31622.8 nM |
Potency |
via CMAUP
|
CHEMBL3356 | P05177 | Cytochrome P450 1A2 |
5011.87 nM |
AC50 |
via CMAUP
|
CHEMBL3622 | P33261 | Cytochrome P450 2C19 |
12589.25 nM |
AC50 |
via CMAUP
|
CHEMBL3397 | P11712 | Cytochrome P450 2C9 |
19952.6 nM |
Potency |
via CMAUP
|
CHEMBL289 | P10635 | Cytochrome P450 2D6 |
15848.9 nM |
Potency |
via CMAUP
|
CHEMBL340 | P08684 | Cytochrome P450 3A4 |
3162.3 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL4159 | Q99714 | Endoplasmic reticulum-associated amyloid beta-peptide-binding protein |
10000 nM |
Potency |
via CMAUP
|
CHEMBL2789 | P37059 | Estradiol 17-beta-dehydrogenase 2 |
360 nM |
IC50 |
via Super-PRED
|
CHEMBL242 | Q92731 | Estrogen receptor beta |
269 nM |
IC50 |
via Super-PRED
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
251.2 nM 251.2 nM |
Potency Potency |
via Super-PRED
via CMAUP |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit |
3162.3 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1075189 | P14618 | Pyruvate kinase isozymes M1/M2 |
15848.9 nM 15848.9 nM |
Potency Potency |
via CMAUP
via CMAUP |
CHEMBL1293256 | P40225 | Thrombopoietin |
3162.3 nM 3162.3 nM |
Potency Potency |
via CMAUP
via CMAUP |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.99% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 95.74% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.11% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.29% | 86.33% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 86.52% | 96.12% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.79% | 90.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.31% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 83.16% | 98.95% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.41% | 91.71% |
CHEMBL2535 | P11166 | Glucose transporter | 81.12% | 98.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.84% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 80.48% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cicer arietinum |
Dracaena draco |
Glycyrrhiza glabra |
Glycyrrhiza inflata |
Glycyrrhiza uralensis |
Glycyrrhiza yunnanensis |
Onobrychis viciifolia |
Robinia pseudoacacia |
Sophora tomentosa |
Spatholobus suberectus |
PubChem | 6603886 |
NPASS | NPC115159 |
ChEMBL | CHEMBL1395334 |