LongipedlactoneB
Internal ID | 2864810f-d3fd-461d-bd35-b707a21dc9dc |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones |
IUPAC Name | (1S,9R,12S,13R,16S,18S)-1-hydroxy-8,8,13-trimethyl-17-methylidene-16-[(1R)-1-[(2R)-5-methyl-6-oxo-2,3-dihydropyran-2-yl]ethyl]-7-oxatetracyclo[10.7.0.03,9.013,18]nonadeca-2,4-dien-6-one |
SMILES (Canonical) | CC1=CCC(OC1=O)C(C)C2CCC3(C4CCC5C(=CC4(CC3C2=C)O)C=CC(=O)OC5(C)C)C |
SMILES (Isomeric) | CC1=CC[C@@H](OC1=O)[C@H](C)[C@@H]2CC[C@]3([C@@H]4CC[C@@H]5C(=C[C@]4(C[C@H]3C2=C)O)C=CC(=O)OC5(C)C)C |
InChI | InChI=1S/C30H40O5/c1-17-7-10-24(34-27(17)32)19(3)21-13-14-29(6)23(18(21)2)16-30(33)15-20-8-12-26(31)35-28(4,5)22(20)9-11-25(29)30/h7-8,12,15,19,21-25,33H,2,9-11,13-14,16H2,1,3-6H3/t19-,21-,22-,23+,24-,25+,29-,30-/m1/s1 |
InChI Key | NHRSXCUUAIYPDX-SSFSOOTESA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H40O5 |
Molecular Weight | 480.60 g/mol |
Exact Mass | 480.28757437 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 5.10 |
LongipedlactoneB |
Longipedlactone B |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.67% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.82% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.66% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 94.35% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.27% | 94.75% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.21% | 94.45% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.17% | 93.56% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.50% | 97.09% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.45% | 97.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.30% | 89.00% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 84.96% | 96.77% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 83.58% | 93.03% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 82.92% | 90.08% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.89% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.74% | 100.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.47% | 93.40% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.34% | 95.89% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.91% | 96.61% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.20% | 93.04% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.16% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Kadsura coccinea |
PubChem | 11525863 |
LOTUS | LTS0087542 |
wikiData | Q105179563 |