Loganic acid 6'-glucoside
Internal ID | e1574d7b-ddaa-4a62-9614-9f16166ae8c3 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | (1S,4aS,6S,7R,7aS)-6-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2C(=O)O)OC3C(C(C(C(O3)COC4C(C(C(C(O4)CO)O)O)O)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2C(=O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O)O |
InChI | InChI=1S/C22H34O15/c1-6-9(24)2-7-8(19(31)32)4-33-20(12(6)7)37-22-18(30)16(28)14(26)11(36-22)5-34-21-17(29)15(27)13(25)10(3-23)35-21/h4,6-7,9-18,20-30H,2-3,5H2,1H3,(H,31,32)/t6-,7+,9-,10+,11+,12+,13+,14+,15-,16-,17+,18+,20-,21+,22-/m0/s1 |
InChI Key | XCXZPJYVZYGBQA-QKPADMPASA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H34O15 |
Molecular Weight | 538.50 g/mol |
Exact Mass | 538.18977037 g/mol |
Topological Polar Surface Area (TPSA) | 245.00 Ų |
XlogP | -3.90 |
Loganic acid 6 inverted exclamation marka-O-|A-D-glucoside |
176226-39-4 |
HY-N9000 |
Loganic acid 6??-O-??-D-glucoside |
AKOS040760846 |
8-Epi-Loganic acid-6'-O-b-D-glucoside |
CS-0149527 |
(1S,4aS,6S,7R,7aS)-6-hydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylic acid |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.07% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.88% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.97% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.10% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.04% | 94.73% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.30% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 88.02% | 86.92% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.50% | 96.61% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.04% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.55% | 90.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.83% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 83.33% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.24% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dipsacus inermis |
PubChem | 101696514 |
LOTUS | LTS0043136 |
wikiData | Q105325535 |