Lindechunine A
| Internal ID | 85ff5e27-31c7-457d-8101-09478adc4f00 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 17-hydroxy-7,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14(19),15,17-octaen-13-one |
| SMILES (Canonical) | COC1=C2C(=C3C4=C(C=CC(=C4OC)O)C(=O)C5=NC=CC1=C35)OCO2 |
| SMILES (Isomeric) | COC1=C2C(=C3C4=C(C=CC(=C4OC)O)C(=O)C5=NC=CC1=C35)OCO2 |
| InChI | InChI=1S/C19H13NO6/c1-23-16-9-5-6-20-14-11(9)13(18-19(16)26-7-25-18)12-8(15(14)22)3-4-10(21)17(12)24-2/h3-6,21H,7H2,1-2H3 |
| InChI Key | ZLFKJSKABHQLAQ-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H13NO6 |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.07428713 g/mol |
| Topological Polar Surface Area (TPSA) | 87.10 Ų |
| XlogP | 3.00 |
| 11-hydroxy-4,12-dimethoxy-8H-[1,3]benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one |
| CHEBI:66577 |
| Q27135192 |
| 8H-1,3-Benzodioxolo[6,5,4-de]benzo[g]quinolin-8-one, 11-hydroxy-4,12-dimethoxy- |
| 17-hydroxy-7,18-dimethoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1,6,8(20),9,11,14(19),15,17-octaen-13-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.88% | 91.11% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.08% | 89.00% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.87% | 91.49% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.38% | 94.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.99% | 96.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.84% | 99.23% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.84% | 98.95% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 92.41% | 96.67% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 92.32% | 93.10% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 91.36% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.64% | 95.56% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.60% | 96.77% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.09% | 83.82% |
| CHEMBL5311 | P37023 | Serine/threonine-protein kinase receptor R3 | 89.85% | 82.67% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.13% | 86.33% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.06% | 85.14% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.34% | 93.99% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 84.44% | 96.00% |
| CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 83.44% | 80.78% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.36% | 94.45% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.70% | 100.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 80.09% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Lindera chunii |
| PubChem | 497803 |
| LOTUS | LTS0082121 |
| wikiData | Q27135192 |