Lindcarpine
| Internal ID | 438ae382-63a3-4656-8011-a7afb6eabe68 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | 1,10-dimethoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,11-diol |
| SMILES (Canonical) | COC1=C(C2=C(CC3C4=C2C(=C(C=C4CCN3)O)OC)C=C1)O |
| SMILES (Isomeric) | COC1=C(C2=C(CC3C4=C2C(=C(C=C4CCN3)O)OC)C=C1)O |
| InChI | InChI=1S/C18H19NO4/c1-22-13-4-3-9-7-11-14-10(5-6-19-11)8-12(20)18(23-2)16(14)15(9)17(13)21/h3-4,8,11,19-21H,5-7H2,1-2H3 |
| InChI Key | JMRVKYVGFUVICI-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.13140809 g/mol |
| Topological Polar Surface Area (TPSA) | 71.00 Ų |
| XlogP | 2.30 |
| LINDCARPINE |
| NSC-288018 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.71% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.58% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.67% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.05% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.75% | 94.45% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.02% | 97.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 91.67% | 95.62% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.83% | 95.56% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 89.74% | 88.48% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.67% | 95.89% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.40% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.33% | 90.00% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.27% | 98.11% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 88.17% | 91.79% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.56% | 92.94% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 86.98% | 92.68% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.09% | 99.17% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 85.59% | 91.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.35% | 94.00% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.09% | 89.62% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.74% | 94.75% |
| CHEMBL261 | P00915 | Carbonic anhydrase I | 83.74% | 96.76% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.97% | 91.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 82.23% | 98.75% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.05% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Actinodaphne pruinosa |
| Glaucium fimbrilligerum |
| Lindera pipericarpa |
| Phoebe grandis |
| PubChem | 324086 |
| LOTUS | LTS0222054 |
| wikiData | Q105131612 |